8-Methylnaringenin
Internal ID | dfd30922-76a3-410c-b519-b7450c68a9b8 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > Flavanones |
IUPAC Name | (2S)-5,7-dihydroxy-2-(4-hydroxyphenyl)-8-methyl-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC1=C2C(=C(C=C1O)O)C(=O)CC(O2)C3=CC=C(C=C3)O |
SMILES (Isomeric) | CC1=C2C(=C(C=C1O)O)C(=O)C[C@H](O2)C3=CC=C(C=C3)O |
InChI | InChI=1S/C16H14O5/c1-8-11(18)6-12(19)15-13(20)7-14(21-16(8)15)9-2-4-10(17)5-3-9/h2-6,14,17-19H,7H2,1H3/t14-/m0/s1 |
InChI Key | GMVYLXBMPRDZDR-AWEZNQCLSA-N |
Popularity | 3 references in papers |
Molecular Formula | C16H14O5 |
Molecular Weight | 286.28 g/mol |
Exact Mass | 286.08412354 g/mol |
Topological Polar Surface Area (TPSA) | 87.00 Ų |
XlogP | 2.80 |
CHEMBL426154 |
AKOS037515064 |
FS-7089 |
PD183336 |
(2s)-4',5,7-trihydroxy-8-methylflavanone |
5,7,4 inverted exclamation mark -Trihydroxy-8-methylflavanone |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL242 | Q92731 | Estrogen receptor beta |
863 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.18% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.66% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 92.11% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.63% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.44% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.82% | 99.23% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 85.83% | 85.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.55% | 94.73% |
CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 83.88% | 90.93% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.55% | 90.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.90% | 94.45% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.79% | 99.15% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.59% | 90.71% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.98% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.68% | 94.00% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.92% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Rhododendron spinuliferum |
PubChem | 44418717 |
LOTUS | LTS0052032 |
wikiData | Q105012192 |