8-Methoxy-4-oxochromene-2-carboxylic acid
Internal ID | 31c2ab7f-b47d-4a1e-bae5-9f16b89a6a78 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
IUPAC Name | 8-methoxy-4-oxochromene-2-carboxylic acid |
SMILES (Canonical) | COC1=CC=CC2=C1OC(=CC2=O)C(=O)O |
SMILES (Isomeric) | COC1=CC=CC2=C1OC(=CC2=O)C(=O)O |
InChI | InChI=1S/C11H8O5/c1-15-8-4-2-3-6-7(12)5-9(11(13)14)16-10(6)8/h2-5H,1H3,(H,13,14) |
InChI Key | FRLMMCULHNSRQO-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C11H8O5 |
Molecular Weight | 220.18 g/mol |
Exact Mass | 220.03717335 g/mol |
Topological Polar Surface Area (TPSA) | 72.80 Ų |
XlogP | 1.60 |
8-methoxy-4-oxochromene-2-carboxylic acid |
SCHEMBL5558100 |
8-methoxy-4-oxo-chromene-2-carboxylic acid |
8-Methoxy-4-oxo-4H-1-benzopyran-2-carboxylic acid |
5537-12-2 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.32% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.26% | 95.56% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.81% | 91.11% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.48% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 91.22% | 98.75% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 90.66% | 90.20% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 90.55% | 95.50% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.50% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.04% | 99.17% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.74% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.06% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.03% | 94.00% |
CHEMBL3202 | P48147 | Prolyl endopeptidase | 83.13% | 90.65% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.20% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.66% | 92.62% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.86% | 85.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Halenia elliptica |
PubChem | 455310 |
LOTUS | LTS0078308 |
wikiData | Q105000245 |