8-methoxy-3-methyl-9H-carbazol-2-ol
| Internal ID | 6f0c99d0-2efc-48ed-849f-545c104f880d |
| Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Carbazoles |
| IUPAC Name | 8-methoxy-3-methyl-9H-carbazol-2-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H13NO2/c1-8-6-10-9-4-3-5-13(17-2)14(9)15-11(10)7-12(8)16/h3-7,15-16H,1-2H3 |
| InChI Key | KKIHCNHEXVGCGP-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.094628657 g/mol |
| Topological Polar Surface Area (TPSA) | 45.30 Ų |
| XlogP | 3.40 |
| 8-methoxy-3-methyl-9H-carbazol-2-ol |
| CHEMBL4073893 |
| 2-hydroxy-8-methoxy-3-methylcarbazole |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.06% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.84% | 95.56% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.39% | 91.79% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.22% | 93.99% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 92.04% | 91.71% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.38% | 98.75% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.82% | 96.09% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 90.68% | 93.31% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 90.06% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.96% | 94.00% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 89.91% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.17% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.07% | 98.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.69% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.86% | 89.62% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 82.79% | 93.24% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 82.16% | 100.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 81.58% | 90.20% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 81.55% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glycosmis pentaphylla |
| PubChem | 10398832 |
| LOTUS | LTS0220202 |
| wikiData | Q105142207 |