8-iso Prostaglandin E1
Internal ID | 4cfd0771-70e9-48eb-8599-e652ff00db79 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Eicosanoids > Prostaglandins and related compounds |
IUPAC Name | 7-[3-hydroxy-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
SMILES (Canonical) | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
SMILES (Isomeric) | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25) |
InChI Key | GMVPRGQOIOIIMI-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C20H34O5 |
Molecular Weight | 354.50 g/mol |
Exact Mass | 354.24062418 g/mol |
Topological Polar Surface Area (TPSA) | 94.80 Ų |
XlogP | 3.20 |
Atomic LogP (AlogP) | 3.48 |
H-Bond Acceptor | 4 |
H-Bond Donor | 3 |
Rotatable Bonds | 13 |
7-[3-hydroxy-2-(3-hydroxyoct-1-enyl)-5-oxocyclopentyl]heptanoic acid |
Ovinonic acid |
211105-33-8 |
8-ISOPROSTAGLANDINE1 |
SCHEMBL5303767 |
HMS3394L11 |
HMS3654H18 |
FT-0603510 |
FT-0638061 |
FT-0638072 |
There are more than 10 synonyms. If you wish to see them all click here. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9681 | 96.81% |
Caco-2 | - | 0.8075 | 80.75% |
Blood Brain Barrier | - | 0.8250 | 82.50% |
Human oral bioavailability | - | 0.9429 | 94.29% |
Subcellular localzation | Mitochondria | 0.8162 | 81.62% |
OATP2B1 inhibitior | - | 0.8552 | 85.52% |
OATP1B1 inhibitior | + | 0.8955 | 89.55% |
OATP1B3 inhibitior | + | 0.9430 | 94.30% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.9250 | 92.50% |
BSEP inhibitior | - | 0.7351 | 73.51% |
P-glycoprotein inhibitior | - | 0.8050 | 80.50% |
P-glycoprotein substrate | - | 0.6295 | 62.95% |
CYP3A4 substrate | + | 0.5696 | 56.96% |
CYP2C9 substrate | - | 0.8032 | 80.32% |
CYP2D6 substrate | - | 0.8704 | 87.04% |
CYP3A4 inhibition | - | 0.8309 | 83.09% |
CYP2C9 inhibition | - | 0.9502 | 95.02% |
CYP2C19 inhibition | - | 0.9025 | 90.25% |
CYP2D6 inhibition | - | 0.9231 | 92.31% |
CYP1A2 inhibition | - | 0.9045 | 90.45% |
CYP2C8 inhibition | - | 0.8814 | 88.14% |
CYP inhibitory promiscuity | - | 0.9725 | 97.25% |
UGT catelyzed | + | 0.9000 | 90.00% |
Carcinogenicity (binary) | - | 0.9300 | 93.00% |
Carcinogenicity (trinary) | Non-required | 0.7224 | 72.24% |
Eye corrosion | - | 0.9914 | 99.14% |
Eye irritation | - | 0.9541 | 95.41% |
Skin irritation | + | 0.5568 | 55.68% |
Skin corrosion | - | 0.8674 | 86.74% |
Ames mutagenesis | - | 0.8778 | 87.78% |
Human Ether-a-go-go-Related Gene inhibition | - | 0.5281 | 52.81% |
Micronuclear | - | 0.9400 | 94.00% |
Hepatotoxicity | - | 0.6351 | 63.51% |
skin sensitisation | - | 0.8636 | 86.36% |
Respiratory toxicity | + | 0.9333 | 93.33% |
Reproductive toxicity | + | 1.0000 | 100.00% |
Mitochondrial toxicity | + | 0.9500 | 95.00% |
Nephrotoxicity | - | 0.7592 | 75.92% |
Acute Oral Toxicity (c) | III | 0.6983 | 69.83% |
Estrogen receptor binding | + | 0.8905 | 89.05% |
Androgen receptor binding | + | 0.7156 | 71.56% |
Thyroid receptor binding | + | 0.5146 | 51.46% |
Glucocorticoid receptor binding | + | 0.7511 | 75.11% |
Aromatase binding | - | 0.7513 | 75.13% |
PPAR gamma | + | 0.5601 | 56.01% |
Honey bee toxicity | - | 0.9457 | 94.57% |
Biodegradation | - | 0.5500 | 55.00% |
Crustacea aquatic toxicity | + | 0.5665 | 56.65% |
Fish aquatic toxicity | + | 0.9878 | 98.78% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha |
10 nM |
Potency |
via Super-PRED
|
CHEMBL4040 | P28482 | MAP kinase ERK2 |
20 nM |
Potency |
via Super-PRED
|
CHEMBL1293235 | P02545 | Prelamin-A/C |
6.3 nM |
Potency |
via Super-PRED
|
CHEMBL1881 | P43116 | Prostanoid EP2 receptor |
16.5 nM |
EC50 |
via Super-PRED
|
CHEMBL1963 | P16473 | Thyroid stimulating hormone receptor |
10 nM 2.5 nM |
Potency Potency |
via Super-PRED
via Super-PRED |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.09% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.43% | 96.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.62% | 99.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.39% | 91.11% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 94.56% | 89.63% |
CHEMBL299 | P17252 | Protein kinase C alpha | 94.12% | 98.03% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.77% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.39% | 92.08% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 88.42% | 96.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.27% | 95.56% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.87% | 90.71% |
CHEMBL5285 | Q99683 | Mitogen-activated protein kinase kinase kinase 5 | 87.22% | 92.26% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 86.84% | 100.00% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 86.42% | 97.79% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.66% | 100.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.53% | 91.19% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.39% | 99.23% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.67% | 92.50% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.50% | 94.73% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.45% | 97.05% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.44% | 97.29% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.88% | 91.81% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 80.96% | 95.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.71% | 89.00% |
CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 80.04% | 98.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Larix sibirica |
Populus balsamifera |
PubChem | 214 |
LOTUS | LTS0035296 |
wikiData | Q105012191 |