8-(Hydroxymethyl)-4b,8-dimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-ol
| Internal ID | 123e8c5c-2d67-4b59-957f-78055f1152e0 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids |
| IUPAC Name | 8-(hydroxymethyl)-4b,8-dimethyl-1-propan-2-yl-5,6,7,8a,9,10-hexahydrophenanthren-2-ol |
| SMILES (Canonical) | CC(C)C1=C(C=CC2=C1CCC3C2(CCCC3(C)CO)C)O |
| SMILES (Isomeric) | CC(C)C1=C(C=CC2=C1CCC3C2(CCCC3(C)CO)C)O |
| InChI | InChI=1S/C20H30O2/c1-13(2)18-14-6-9-17-19(3,12-21)10-5-11-20(17,4)15(14)7-8-16(18)22/h7-8,13,17,21-22H,5-6,9-12H2,1-4H3 |
| InChI Key | NFEAIVZJRVEKFD-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.50 g/mol |
| Exact Mass | 302.224580195 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 5.30 |
| NSC251689 |
| DTXSID70945555 |
| NSC-251689 |
| 14-(Propan-2-yl)podocarpa-8,11,13-triene-13,15-diol |
| [1S-(1.ALPHA.,10A.BETA.)]-1,2,3,4,4A,9,10,10A-OCTAHYDRO-7-HYDROXY-1,4A-DIMETHYL-8-(1-METHYLETHYL)-1-PHENANTHRENEMETHANOL |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.16% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.38% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.78% | 96.09% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.47% | 93.99% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.96% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.49% | 94.45% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.70% | 95.89% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.54% | 97.09% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.71% | 94.75% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 87.30% | 90.24% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.95% | 99.15% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 86.02% | 100.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.67% | 95.56% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.45% | 93.56% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.35% | 90.71% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.12% | 90.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 82.75% | 100.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.31% | 95.93% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.88% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Nageia nagi |
| Podocarpus sylvestris |
| Podocarpus totara |
| Retrophyllum comptonii |
| PubChem | 317837 |
| LOTUS | LTS0127240 |
| wikiData | Q82922936 |