8-(Hydroxymethyl)-13-methoxytricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,8,12,14-heptaene-4,5-diol
| Internal ID | e74d10a5-5fb9-4db3-bc92-493b6684960a |
| Taxonomy | Benzenoids > Phenol ethers > Anisoles |
| IUPAC Name | 8-(hydroxymethyl)-13-methoxytricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,8,12,14-heptaene-4,5-diol |
| SMILES (Canonical) | COC1=CC2=C(C=C1)C3=CC(=C(C=C3C(=CC2)CO)O)O |
| SMILES (Isomeric) | COC1=CC2=C(C=C1)C3=CC(=C(C=C3C(=CC2)CO)O)O |
| InChI | InChI=1S/C17H16O4/c1-21-12-4-5-13-10(6-12)2-3-11(9-18)14-7-16(19)17(20)8-15(13)14/h3-8,18-20H,2,9H2,1H3 |
| InChI Key | KNVBAXXBALZGAJ-UHFFFAOYSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10485899 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of 8-(Hydroxymethyl)-13-methoxytricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,8,12,14-heptaene-4,5-diol](https://plantaedb.com/storage/docs/compounds/2023/11/8-hydroxymethyl-13-methoxytricyclo940027pentadeca-11124681214-heptaene-45-diol.jpg "2D Structure of 8-(Hydroxymethyl)-13-methoxytricyclo[9.4.0.02,7]pentadeca-1(11),2,4,6,8,12,14-heptaene-4,5-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.10% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 97.49% | 93.99% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.06% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.98% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.63% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 92.76% | 91.49% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 91.15% | 90.00% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 89.91% | 93.31% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.88% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.48% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.42% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.51% | 99.17% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.46% | 95.89% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 82.75% | 90.24% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.49% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cinnamomum subavenium |
| PubChem | 135025051 |
| LOTUS | LTS0159126 |
| wikiData | Q105143598 |