8-Hydroxy-9-oxo-9H-xanthene-1,3-dicarboxylic acid
Internal ID | 02cb6ded-525e-4c5e-ade5-58450c124ac3 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | 8-hydroxy-9-oxoxanthene-1,3-dicarboxylic acid |
SMILES (Canonical) | C1=CC(=C2C(=C1)OC3=CC(=CC(=C3C2=O)C(=O)O)C(=O)O)O |
SMILES (Isomeric) | C1=CC(=C2C(=C1)OC3=CC(=CC(=C3C2=O)C(=O)O)C(=O)O)O |
InChI | InChI=1S/C15H8O7/c16-8-2-1-3-9-12(8)13(17)11-7(15(20)21)4-6(14(18)19)5-10(11)22-9/h1-5,16H,(H,18,19)(H,20,21) |
InChI Key | KSDHRLBMSUYFBZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H8O7 |
Molecular Weight | 300.22 g/mol |
Exact Mass | 300.02700259 g/mol |
Topological Polar Surface Area (TPSA) | 121.00 Ų |
XlogP | 2.20 |
8-HYDROXY-9-OXO-9H-XANTHENE-1,3-DICARBOXYLIC ACID |
DTXSID60782815 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 96.86% | 87.67% |
CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 93.49% | 81.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.03% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 92.88% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 92.06% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.96% | 86.33% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.90% | 91.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 90.09% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.13% | 83.82% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.61% | 89.00% |
CHEMBL2535 | P11166 | Glucose transporter | 87.98% | 98.75% |
CHEMBL1811 | P34995 | Prostanoid EP1 receptor | 87.68% | 95.71% |
CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 84.08% | 94.42% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 83.42% | 93.99% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.50% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Senna alata |
Senna reticulata |
PubChem | 71358891 |
LOTUS | LTS0038426 |
wikiData | Q82747355 |