8-Hydroxy-2-methyl-4H-1-benzopyran-4-one
| Internal ID | 05ce037c-47f7-43a6-b5ad-ee330b74912a |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | 8-hydroxy-2-methylchromen-4-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C(=CC=C2)O |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C(=CC=C2)O |
| InChI | InChI=1S/C10H8O3/c1-6-5-9(12)7-3-2-4-8(11)10(7)13-6/h2-5,11H,1H3 |
| InChI Key | DLHGNEVRISSXIV-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.047344113 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.60 |
| 8-hydroxy-2-methyl-chromen-4-one |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.21% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.67% | 91.11% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 96.63% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 94.95% | 98.95% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 91.26% | 91.49% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.15% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 89.65% | 99.23% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.79% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.85% | 94.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.00% | 94.75% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.95% | 86.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.83% | 99.15% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 82.21% | 93.65% |
| CHEMBL2535 | P11166 | Glucose transporter | 81.25% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Halenia elliptica |
| PubChem | 57330137 |
| LOTUS | LTS0220876 |
| wikiData | Q104984295 |