8-Hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one
| Internal ID | 3c9529ac-b4b6-4ed6-b0dc-c7cfbc25d120 |
| Taxonomy | Alkaloids and derivatives > Indolonaphthyridine alkaloids |
| IUPAC Name | 8-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one |
| SMILES (Canonical) | C1CC(=O)N2C3=CC=CC=C3C4=C2C1=NC=C4O |
| SMILES (Isomeric) | C1CC(=O)N2C3=CC=CC=C3C4=C2C1=NC=C4O |
| InChI | InChI=1S/C14H10N2O2/c17-11-7-15-9-5-6-12(18)16-10-4-2-1-3-8(10)13(11)14(9)16/h1-4,7,17H,5-6H2 |
| InChI Key | BFQMUVXDFIJSPW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.074227566 g/mol |
| Topological Polar Surface Area (TPSA) | 55.10 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of 8-Hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/8-hydroxy-16-diazatetracyclo761051601015hexadeca-57916101214-hexaen-2-one.jpg "2D Structure of 8-Hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10,12,14-hexaen-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.00% | 95.56% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 96.80% | 91.49% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 95.10% | 93.99% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.07% | 99.23% |
| CHEMBL1899 | P46098 | Serotonin 3a (5-HT3a) receptor | 88.99% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.65% | 89.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 88.05% | 98.75% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 87.19% | 85.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.41% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 85.71% | 94.00% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.38% | 91.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 84.51% | 93.65% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 84.19% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.05% | 98.95% |
| CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 82.58% | 97.33% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.33% | 99.15% |
| CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.98% | 88.00% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 81.76% | 94.62% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 81.18% | 92.67% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 80.97% | 80.71% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.79% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Eurycoma longifolia |
| PubChem | 162873419 |
| LOTUS | LTS0179188 |
| wikiData | Q104934723 |