8-Dimethylallyllisetin
Internal ID | 42ce8612-b38c-42c1-8608-97f6bada5c4a |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflav-2-enes > Isoflavones |
IUPAC Name | 1,3,8-trihydroxy-9-methoxy-4,7-bis(3-methylbut-2-enyl)-[1]benzofuro[2,3-b]chromen-11-one |
SMILES (Canonical) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C3=C(O2)OC4=C(C(=C(C=C34)OC)O)CC=C(C)C)C |
SMILES (Isomeric) | CC(=CCC1=C2C(=C(C=C1O)O)C(=O)C3=C(O2)OC4=C(C(=C(C=C34)OC)O)CC=C(C)C)C |
InChI | InChI=1S/C26H26O7/c1-12(2)6-8-14-17(27)11-18(28)21-23(30)20-16-10-19(31-5)22(29)15(9-7-13(3)4)24(16)32-26(20)33-25(14)21/h6-7,10-11,27-29H,8-9H2,1-5H3 |
InChI Key | GQRNMTDWOFXCTJ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H26O7 |
Molecular Weight | 450.50 g/mol |
Exact Mass | 450.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 109.00 Ų |
XlogP | 7.00 |
8-Dimethylallyllisetin |
LMPK12160008 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.52% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.95% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.03% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.71% | 94.00% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 90.72% | 98.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.65% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.50% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.17% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.41% | 99.17% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 87.96% | 94.75% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.86% | 89.34% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.68% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 86.37% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 85.49% | 91.49% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.62% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.46% | 96.95% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 83.08% | 96.00% |
CHEMBL3194 | P02766 | Transthyretin | 81.58% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Piscidia piscipula |
PubChem | 44260101 |
LOTUS | LTS0054244 |
wikiData | Q105015541 |