8-Deoxy-11-hydroxy-13-chlorogrosheimin
| Internal ID | 78f1dbbf-7826-435f-80b6-a0dc00891cb7 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene lactones > Sesquiterpene lactones > Guaianolides and derivatives |
| IUPAC Name | 3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]furan-2,8-dione |
| SMILES (Canonical) | CC1C2C(CC1=O)C(=C)CCC3C2OC(=O)C3(CCl)O |
| SMILES (Isomeric) | CC1C2C(CC1=O)C(=C)CCC3C2OC(=O)C3(CCl)O |
| InChI | InChI=1S/C15H19ClO4/c1-7-3-4-10-13(20-14(18)15(10,19)6-16)12-8(2)11(17)5-9(7)12/h8-10,12-13,19H,1,3-6H2,2H3 |
| InChI Key | RXUIKPFKVDKIDO-UHFFFAOYSA-N |
| Popularity | 4 references in papers |
| Molecular Formula | C15H19ClO4 |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.0971868 g/mol |
| Topological Polar Surface Area (TPSA) | 63.60 Ų |
| XlogP | 1.20 |
| CHEBI:183560 |
| DTXSID501119835 |
| 3-(chloromethyl)-3-hydroxy-9-methyl-6-methylidene-3a,4,5,6a,7,9,9a,9b-octahydroazuleno[4,5-b]uran-2,8-dione |
| 3-(Chloromethyl)octahydro-3-hydroxy-9-methyl-6-methyleneazuleno[4,5-b]furan-2,8(3H,4H)-dione |
| 83551-02-4 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.51% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.12% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.16% | 96.09% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 88.10% | 96.77% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.07% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.56% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.77% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.17% | 98.95% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 83.75% | 95.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.43% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.88% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Cynara cardunculus |
| PubChem | 131753015 |
| LOTUS | LTS0054456 |
| wikiData | Q105247288 |