8-Daucene-2,4,6-triol, O-(4-Hydroxybenzoyl), 2-Ac
Internal ID | 2e1875bf-b3b9-42c4-aa39-7efe81ef0909 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | [(1S,3R,3aS,4S,8aR)-1-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-hydroxybenzoate |
SMILES (Canonical) | CC1=CCC2(C(CC(C2C(C1)OC(=O)C3=CC=C(C=C3)O)(C(C)C)O)OC(=O)C)C |
SMILES (Isomeric) | CC1=CC[C@]2([C@H](C[C@]([C@@H]2[C@H](C1)OC(=O)C3=CC=C(C=C3)O)(C(C)C)O)OC(=O)C)C |
InChI | InChI=1S/C24H32O6/c1-14(2)24(28)13-20(29-16(4)25)23(5)11-10-15(3)12-19(21(23)24)30-22(27)17-6-8-18(26)9-7-17/h6-10,14,19-21,26,28H,11-13H2,1-5H3/t19-,20-,21+,23-,24+/m0/s1 |
InChI Key | CHQMIQBQLGDCJJ-AAGTZVQDSA-N |
Popularity | 3 references in papers |
Molecular Formula | C24H32O6 |
Molecular Weight | 416.50 g/mol |
Exact Mass | 416.21988874 g/mol |
Topological Polar Surface Area (TPSA) | 93.10 Ų |
XlogP | 4.10 |
AKOS040740003 |
NCGC00347654-02 |
[(1S,3R,3aS,4S,8aR)-1-acetyloxy-3-hydroxy-6,8a-dimethyl-3-propan-2-yl-1,2,3a,4,5,8-hexahydroazulen-4-yl] 4-hydroxybenzoate |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.22% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 94.81% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.89% | 91.11% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 92.20% | 97.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 91.00% | 97.79% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 89.01% | 91.19% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.68% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.48% | 90.00% |
CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 87.44% | 97.53% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.07% | 86.33% |
CHEMBL2535 | P11166 | Glucose transporter | 86.38% | 98.75% |
CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 86.15% | 94.97% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.13% | 95.56% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.90% | 95.89% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.82% | 89.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.04% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.28% | 100.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.17% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ferula communis |
PubChem | 14396666 |
LOTUS | LTS0066852 |
wikiData | Q104959123 |