8-C-Methylquercetagetin 3,6,7,3'-tetramethyl ether
| Internal ID | fdc6646b-dc0f-4abf-9352-97b74c130bb8 |
| Taxonomy | Phenylpropanoids and polyketides > Flavonoids > O-methylated flavonoids > 7-O-methylated flavonoids |
| IUPAC Name | 5-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,6,7-trimethoxy-8-methylchromen-4-one |
| SMILES (Canonical) | CC1=C2C(=C(C(=C1OC)OC)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)OC)OC |
| SMILES (Isomeric) | CC1=C2C(=C(C(=C1OC)OC)O)C(=O)C(=C(O2)C3=CC(=C(C=C3)O)OC)OC |
| InChI | InChI=1S/C20H20O8/c1-9-16-13(14(22)19(26-4)17(9)25-3)15(23)20(27-5)18(28-16)10-6-7-11(21)12(8-10)24-2/h6-8,21-22H,1-5H3 |
| InChI Key | UTIXQANYHCSQSU-UHFFFAOYSA-N |
| Popularity | 5 references in papers |
| Molecular Formula | C20H20O8 |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.11581759 g/mol |
| Topological Polar Surface Area (TPSA) | 104.00 Ų |
| XlogP | 3.50 |
| LMPK12112980 |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.51% | 91.11% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 97.28% | 94.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.80% | 99.15% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.66% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.25% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.86% | 86.33% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 92.74% | 98.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.73% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.36% | 94.45% |
| CHEMBL3194 | P02766 | Transthyretin | 84.88% | 90.71% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 83.86% | 93.65% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.41% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.22% | 99.17% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.76% | 95.50% |
| CHEMBL5903 | Q04771 | Activin receptor type-1 | 80.85% | 89.93% |
| CHEMBL3864 | Q06124 | Protein-tyrosine phosphatase 2C | 80.41% | 94.42% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.40% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vellozia glabra |
| Vellozia laevis |
| Vellozia lilacina |
| Vellozia nanuzae |
| Vellozia stipitata |
| PubChem | 15137941 |
| LOTUS | LTS0167714 |
| wikiData | Q105278824 |