2-[4-Hydroxy-2-(3-hydroxypropyl)-3-(6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dimethylcyclohexylidene]propanal
| Internal ID | 06f96cbb-754c-42c0-8f4e-803ca394d911 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesterterpenoids |
| IUPAC Name | 2-[4-hydroxy-2-(3-hydroxypropyl)-3-(6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dimethylcyclohexylidene]propanal |
| SMILES (Canonical) | CC(=CCCC(=CC(CC(=CCCC1(C(C(=C(C)C=O)CCC1(C)O)CCCO)C)C)O)C)C |
| SMILES (Isomeric) | CC(=CCCC(=CC(CC(=CCCC1(C(C(=C(C)C=O)CCC1(C)O)CCCO)C)C)O)C)C |
| InChI | InChI=1S/C30H50O4/c1-22(2)11-8-12-23(3)19-26(33)20-24(4)13-9-16-29(6)28(14-10-18-31)27(25(5)21-32)15-17-30(29,7)34/h11,13,19,21,26,28,31,33-34H,8-10,12,14-18,20H2,1-7H3 |
| InChI Key | BJDXBDDVBKYQSK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.37091007 g/mol |
| Topological Polar Surface Area (TPSA) | 77.80 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
![2D Structure of 2-[4-Hydroxy-2-(3-hydroxypropyl)-3-(6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dimethylcyclohexylidene]propanal](https://plantaedb.com/storage/docs/compounds/2023/11/7ffd3d70-8678-11ee-9630-2d63a8e73005.jpg "2D Structure of 2-[4-Hydroxy-2-(3-hydroxypropyl)-3-(6-hydroxy-4,8,12-trimethyltrideca-3,7,11-trienyl)-3,4-dimethylcyclohexylidene]propanal")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.01% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.85% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.14% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.03% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 89.62% | 93.10% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.32% | 100.00% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 85.62% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 85.61% | 95.50% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.18% | 95.89% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.08% | 95.56% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.05% | 99.17% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.91% | 97.09% |
| CHEMBL233 | P35372 | Mu opioid receptor | 84.82% | 97.93% |
| CHEMBL5555 | O00767 | Acyl-CoA desaturase | 83.55% | 97.50% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 83.51% | 92.08% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 82.87% | 98.75% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.72% | 100.00% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 80.68% | 92.86% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.29% | 85.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Iris sibirica |
| PubChem | 85302143 |
| LOTUS | LTS0141102 |
| wikiData | Q104936995 |