[(2S,3R,4S,5R,6S)-4,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-5-octanoyloxy-6-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxyoxan-3-yl] octanoate
Internal ID | 156df83c-277b-4c8b-b38d-5997a5abfccb |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Oligosaccharides |
IUPAC Name | [(2S,3R,4S,5R,6S)-4,5-dihydroxy-2-methyl-6-[(2S,3S,4R,5R,6S)-2-methyl-5-octanoyloxy-6-[[(1S,3R,4S,5R,6R,8R,10S,22S,23S,24S,26R)-4,5,26-trihydroxy-6,24-dimethyl-20-oxo-10-pentyl-2,7,9,21,25-pentaoxatricyclo[20.3.1.03,8]hexacosan-23-yl]oxy]-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-3-yl]oxyoxan-3-yl] octanoate |
SMILES (Canonical) | CCCCCCCC(=O)OC1C(OC(C(C1O)O)OC2C(OC(C(C2OC3C(C(C(C(O3)CO)O)O)O)OC(=O)CCCCCCC)OC4C(OC5C(C4OC(=O)CCCCCCCCCC(OC6C(O5)C(C(C(O6)C)O)O)CCCCC)O)C)C)C |
SMILES (Isomeric) | CCCCCCCC(=O)O[C@H]1[C@@H](O[C@H]([C@@H]([C@@H]1O)O)O[C@H]2[C@@H](O[C@H]([C@@H]([C@@H]2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC(=O)CCCCCCC)O[C@H]4[C@@H](O[C@@H]5[C@@H]([C@@H]4OC(=O)CCCCCCCCC[C@@H](O[C@H]6[C@H](O5)[C@H]([C@H]([C@H](O6)C)O)O)CCCCC)O)C)C)C |
InChI | InChI=1S/C62H108O25/c1-8-11-14-19-25-30-40(64)81-51-35(5)76-58(49(73)47(51)71)84-53-37(7)78-62(57(83-42(66)32-26-20-15-12-9-2)56(53)87-59-48(72)45(69)44(68)39(33-63)80-59)85-52-36(6)77-60-50(74)54(52)82-41(65)31-27-22-18-16-17-21-24-29-38(28-23-13-10-3)79-61-55(86-60)46(70)43(67)34(4)75-61/h34-39,43-63,67-74H,8-33H2,1-7H3/t34-,35+,36+,37+,38+,39-,43+,44-,45+,46+,47+,48-,49-,50-,51+,52+,53+,54+,55-,56-,57-,58+,59+,60+,61+,62+/m1/s1 |
InChI Key | PFIYLJOTFZEAHC-RYZYQEKMSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C62H108O25 |
Molecular Weight | 1253.50 g/mol |
Exact Mass | 1252.71796893 g/mol |
Topological Polar Surface Area (TPSA) | 353.00 Ų |
XlogP | 7.20 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 98.70% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.41% | 91.11% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 96.79% | 92.50% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.63% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.54% | 96.09% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 94.35% | 100.00% |
CHEMBL220 | P22303 | Acetylcholinesterase | 92.77% | 94.45% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.67% | 97.36% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.83% | 93.56% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 89.50% | 95.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.43% | 89.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.95% | 92.62% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.54% | 97.79% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.18% | 86.33% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 88.16% | 90.24% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.13% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.12% | 97.09% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 87.80% | 96.21% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.20% | 95.89% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.58% | 94.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 83.38% | 83.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.21% | 91.19% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.83% | 100.00% |
CHEMBL1968 | P07099 | Epoxide hydrolase 1 | 81.42% | 98.57% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 81.06% | 92.08% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.03% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Ipomoea aquatica |
PubChem | 118716656 |
LOTUS | LTS0067273 |
wikiData | Q105207781 |