(1R,2S,6S,7S,10R,11S,16S,18S,19R,20R)-6-(furan-3-yl)-2,18,19,20-tetrahydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14-dione
| Internal ID | 3cc96af1-0de9-4a30-a87e-a9e3ebf22ab5 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Triterpenoids > Limonoids |
| IUPAC Name | (1R,2S,6S,7S,10R,11S,16S,18S,19R,20R)-6-(furan-3-yl)-2,18,19,20-tetrahydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14-dione |
| SMILES (Canonical) | CC1(C2CC(=O)OCC23C4CCC5(C(OC(=O)CC5(C46CC(C1O)(C3(O6)O)O)O)C7=COC=C7)C)C |
| SMILES (Isomeric) | C[C@@]12CC[C@H]3[C@@]4([C@@]1(CC(=O)O[C@H]2C5=COC=C5)O)C[C@]6([C@H](C([C@H]7[C@@]3([C@]6(O4)O)COC(=O)C7)(C)C)O)O |
| InChI | InChI=1S/C26H32O10/c1-20(2)15-8-16(27)34-12-22(15)14-4-6-21(3)18(13-5-7-33-10-13)35-17(28)9-25(21,31)24(14)11-23(30,19(20)29)26(22,32)36-24/h5,7,10,14-15,18-19,29-32H,4,6,8-9,11-12H2,1-3H3/t14-,15+,18+,19+,21+,22-,23-,24-,25+,26-/m1/s1 |
| InChI Key | LXWTWJGKNFFMCZ-NWUUSGLJSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H32O10 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.19954721 g/mol |
| Topological Polar Surface Area (TPSA) | 156.00 Ų |
| XlogP | -0.50 |
| There are no found synonyms. |
![2D Structure of (1R,2S,6S,7S,10R,11S,16S,18S,19R,20R)-6-(furan-3-yl)-2,18,19,20-tetrahydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14-dione](https://plantaedb.com/storage/docs/compounds/2023/11/7f8d76d0-86bb-11ee-bcd7-13141006f6be.jpg "2D Structure of (1R,2S,6S,7S,10R,11S,16S,18S,19R,20R)-6-(furan-3-yl)-2,18,19,20-tetrahydroxy-7,17,17-trimethyl-5,13,21-trioxahexacyclo[17.2.1.01,10.02,7.011,16.011,20]docosane-4,14-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.92% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.85% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.44% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.02% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.88% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.71% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.63% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.73% | 86.33% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 87.28% | 94.45% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.19% | 94.45% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.72% | 97.25% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 86.62% | 82.69% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.79% | 99.23% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 85.78% | 93.04% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.26% | 95.89% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 83.38% | 97.05% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.63% | 93.99% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.04% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Khaya anthotheca |
| PubChem | 163025544 |
| LOTUS | LTS0059136 |
| wikiData | Q105159132 |