[(1S,2R,3R,4R,5R,6S,7S,11R,12R,13R,16R,17R,19S,20S,21R)-14-ethyl-5,17-dihydroxy-6,19,21-trimethoxy-16-(methoxymethyl)-9,9-dimethyl-8,10-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,11.07,11.016,20]docosan-4-yl] benzoate
Internal ID | b5a00ba0-bd8f-43ab-a180-4e9e4c1839b2 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Aconitane-type diterpenoid alkaloids |
IUPAC Name | [(1S,2R,3R,4R,5R,6S,7S,11R,12R,13R,16R,17R,19S,20S,21R)-14-ethyl-5,17-dihydroxy-6,19,21-trimethoxy-16-(methoxymethyl)-9,9-dimethyl-8,10-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,11.07,11.016,20]docosan-4-yl] benzoate |
SMILES (Canonical) | CCN1CC2(C(CC(C34C2C(C(C31)C56C7C4CC(C7OC(=O)C8=CC=CC=C8)(C(C5OC(O6)(C)C)OC)O)OC)OC)O)COC |
SMILES (Isomeric) | CCN1C[C@@]2([C@@H](C[C@@H]([C@@]34[C@@H]2[C@H]([C@@H]([C@H]31)[C@]56[C@@H]7[C@H]4C[C@@]([C@@H]7OC(=O)C8=CC=CC=C8)([C@H]([C@@H]5OC(O6)(C)C)OC)O)OC)OC)O)COC |
InChI | InChI=1S/C35H49NO10/c1-8-36-16-32(17-40-4)20(37)14-21(41-5)34-19-15-33(39)27(44-30(38)18-12-10-9-11-13-18)22(19)35(23(26(34)36)24(42-6)25(32)34)29(28(33)43-7)45-31(2,3)46-35/h9-13,19-29,37,39H,8,14-17H2,1-7H3/t19-,20-,21+,22-,23+,24+,25-,26-,27-,28+,29+,32+,33-,34+,35-/m1/s1 |
InChI Key | WIXUBOBQSVCZPX-SAMGUTFGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C35H49NO10 |
Molecular Weight | 643.80 g/mol |
Exact Mass | 643.33564676 g/mol |
Topological Polar Surface Area (TPSA) | 125.00 Ų |
XlogP | 1.30 |
There are no found synonyms. |
![2D Structure of [(1S,2R,3R,4R,5R,6S,7S,11R,12R,13R,16R,17R,19S,20S,21R)-14-ethyl-5,17-dihydroxy-6,19,21-trimethoxy-16-(methoxymethyl)-9,9-dimethyl-8,10-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,11.07,11.016,20]docosan-4-yl] benzoate 2D Structure of [(1S,2R,3R,4R,5R,6S,7S,11R,12R,13R,16R,17R,19S,20S,21R)-14-ethyl-5,17-dihydroxy-6,19,21-trimethoxy-16-(methoxymethyl)-9,9-dimethyl-8,10-dioxa-14-azaheptacyclo[10.7.2.12,5.01,13.03,11.07,11.016,20]docosan-4-yl] benzoate](https://plantaedb.com/storage/docs/compounds/2023/11/7f8b9440-85cb-11ee-8054-3b3aa3dc7d86.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.53% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 98.04% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.10% | 85.14% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.39% | 90.17% |
CHEMBL2581 | P07339 | Cathepsin D | 93.11% | 98.95% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 93.06% | 99.23% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.86% | 83.82% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 91.18% | 94.08% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.74% | 94.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 86.94% | 94.62% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 86.62% | 92.62% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.26% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.74% | 96.00% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 85.39% | 87.16% |
CHEMBL261 | P00915 | Carbonic anhydrase I | 84.67% | 96.76% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.67% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.94% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.00% | 95.56% |
CHEMBL5028 | O14672 | ADAM10 | 82.41% | 97.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.21% | 97.25% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.56% | 90.00% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.38% | 95.50% |
CHEMBL3891 | P07384 | Calpain 1 | 80.71% | 93.04% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.61% | 91.19% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.32% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Aconitum variegatum |
PubChem | 162972688 |
LOTUS | LTS0126692 |
wikiData | Q105306596 |