1-O-[(3R,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18S,19R)-15,19-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl] 5-O-methyl (3S)-3-hydroxy-3-methylpentanedioate
Internal ID | e451454b-2f31-47d0-b9dc-34d81b33ba5b |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 1-O-[(3R,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18S,19R)-15,19-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl] 5-O-methyl (3S)-3-hydroxy-3-methylpentanedioate |
SMILES (Canonical) | CC1CCC2(C(C3C(O2)CC4C3(CCC5C4CC(C6C5(CC(C(C6)OC7C(C(C(C(O7)CO)OC8C(C(C(C(O8)CO)O)OC9C(C(C(CO9)OC(=O)CC(C)(CC(=O)OC)O)O)O)OC2C(C(C(C(O2)CO)O)O)O)O)O)O)C)O)C)C)OC1 |
SMILES (Isomeric) | C[C@@H]1CC[C@@]2([C@H]([C@H]3[C@@H](O2)C[C@@H]4[C@@]3(CC[C@H]5[C@H]4C[C@H]([C@@H]6[C@@]5(C[C@H]([C@@H](C6)O[C@H]7[C@@H]([C@H]([C@H]([C@H](O7)CO)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O[C@H]9[C@@H]([C@H]([C@@H](CO9)OC(=O)C[C@](C)(CC(=O)OC)O)O)O)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O)O)O)O)C)O)C)C)OC1 |
InChI | InChI=1S/C57H92O28/c1-22-7-10-57(76-20-22)23(2)38-31(85-57)12-26-24-11-28(61)27-13-30(29(62)14-56(27,5)25(24)8-9-55(26,38)4)78-51-46(72)43(69)47(34(19-60)81-51)82-53-49(84-52-45(71)42(68)39(65)32(17-58)79-52)48(41(67)33(18-59)80-53)83-50-44(70)40(66)35(21-75-50)77-37(64)16-54(3,73)15-36(63)74-6/h22-35,38-53,58-62,65-73H,7-21H2,1-6H3/t22-,23+,24-,25+,26+,27-,28-,29-,30-,31+,32-,33-,34-,35-,38+,39-,40+,41-,42+,43-,44-,45-,46-,47+,48+,49-,50+,51-,52+,53+,54+,55+,56-,57-/m1/s1 |
InChI Key | LQXJDZAUTSWWPZ-VILOZUBTSA-N |
Popularity | 0 references in papers |
Molecular Formula | C57H92O28 |
Molecular Weight | 1225.30 g/mol |
Exact Mass | 1224.57751227 g/mol |
Topological Polar Surface Area (TPSA) | 428.00 Ų |
XlogP | -2.80 |
Atomic LogP (AlogP) | -4.07 |
H-Bond Acceptor | 28 |
H-Bond Donor | 14 |
Rotatable Bonds | 16 |
There are no found synonyms. |
![2D Structure of 1-O-[(3R,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18S,19R)-15,19-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl] 5-O-methyl (3S)-3-hydroxy-3-methylpentanedioate 2D Structure of 1-O-[(3R,4R,5R,6S)-6-[(2S,3R,4S,5R,6R)-2-[(2R,3R,4R,5R,6R)-6-[(1R,2S,4S,5'R,6R,7S,8R,9S,12S,13R,15R,16R,18S,19R)-15,19-dihydroxy-5',7,9,13-tetramethylspiro[5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosane-6,2'-oxane]-16-yl]oxy-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-5-hydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-4-yl]oxy-4,5-dihydroxyoxan-3-yl] 5-O-methyl (3S)-3-hydroxy-3-methylpentanedioate](https://plantaedb.com/storage/docs/compounds/2023/11/7f2b3f50-85c4-11ee-b1db-6fb8940e284f.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | - | 0.5000 | 50.00% |
Caco-2 | - | 0.8687 | 86.87% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.7429 | 74.29% |
Subcellular localzation | Mitochondria | 0.7332 | 73.32% |
OATP2B1 inhibitior | - | 1.0000 | 100.00% |
OATP1B1 inhibitior | + | 0.8428 | 84.28% |
OATP1B3 inhibitior | + | 0.9515 | 95.15% |
MATE1 inhibitior | - | 1.0000 | 100.00% |
OCT2 inhibitior | - | 0.5500 | 55.00% |
BSEP inhibitior | + | 0.8683 | 86.83% |
P-glycoprotein inhibitior | + | 0.7421 | 74.21% |
P-glycoprotein substrate | + | 0.6135 | 61.35% |
CYP3A4 substrate | + | 0.7657 | 76.57% |
CYP2C9 substrate | - | 1.0000 | 100.00% |
CYP2D6 substrate | - | 0.8804 | 88.04% |
CYP3A4 inhibition | - | 0.8967 | 89.67% |
CYP2C9 inhibition | - | 0.9189 | 91.89% |
CYP2C19 inhibition | - | 0.9108 | 91.08% |
CYP2D6 inhibition | - | 0.9612 | 96.12% |
CYP1A2 inhibition | - | 0.9322 | 93.22% |
CYP2C8 inhibition | + | 0.7831 | 78.31% |
CYP inhibitory promiscuity | - | 0.9792 | 97.92% |
UGT catelyzed | - | 0.5000 | 50.00% |
Carcinogenicity (binary) | - | 0.9800 | 98.00% |
Carcinogenicity (trinary) | Non-required | 0.6227 | 62.27% |
Eye corrosion | - | 0.9908 | 99.08% |
Eye irritation | - | 0.8998 | 89.98% |
Skin irritation | - | 0.6560 | 65.60% |
Skin corrosion | - | 0.9423 | 94.23% |
Ames mutagenesis | - | 0.7000 | 70.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.7791 | 77.91% |
Micronuclear | - | 0.8600 | 86.00% |
Hepatotoxicity | - | 0.8375 | 83.75% |
skin sensitisation | - | 0.9404 | 94.04% |
Respiratory toxicity | + | 0.7222 | 72.22% |
Reproductive toxicity | + | 0.7556 | 75.56% |
Mitochondrial toxicity | + | 0.5750 | 57.50% |
Nephrotoxicity | - | 0.8291 | 82.91% |
Acute Oral Toxicity (c) | I | 0.6592 | 65.92% |
Estrogen receptor binding | + | 0.8476 | 84.76% |
Androgen receptor binding | + | 0.7307 | 73.07% |
Thyroid receptor binding | + | 0.5982 | 59.82% |
Glucocorticoid receptor binding | + | 0.7302 | 73.02% |
Aromatase binding | + | 0.6309 | 63.09% |
PPAR gamma | + | 0.8094 | 80.94% |
Honey bee toxicity | - | 0.5403 | 54.03% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5400 | 54.00% |
Fish aquatic toxicity | + | 0.7729 | 77.29% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.54% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.32% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.76% | 85.14% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 97.58% | 96.61% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 95.12% | 96.21% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 93.78% | 92.50% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 93.58% | 95.50% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.53% | 97.25% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 92.50% | 96.77% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.27% | 97.09% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 91.19% | 91.24% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 91.14% | 94.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.04% | 94.45% |
CHEMBL220 | P22303 | Acetylcholinesterase | 90.24% | 94.45% |
CHEMBL204 | P00734 | Thrombin | 90.22% | 96.01% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 90.09% | 95.93% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 89.07% | 97.28% |
CHEMBL233 | P35372 | Mu opioid receptor | 89.06% | 97.93% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.01% | 100.00% |
CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 88.96% | 98.75% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 88.41% | 95.71% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.68% | 100.00% |
CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 87.55% | 96.90% |
CHEMBL237 | P41145 | Kappa opioid receptor | 87.39% | 98.10% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 86.74% | 97.14% |
CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.66% | 91.03% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.46% | 89.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 85.54% | 91.19% |
CHEMBL259 | P32245 | Melanocortin receptor 4 | 85.46% | 95.38% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 85.16% | 89.05% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.97% | 97.29% |
CHEMBL5028 | O14672 | ADAM10 | 84.83% | 97.50% |
CHEMBL4685 | P14902 | Indoleamine 2,3-dioxygenase | 84.59% | 96.38% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.03% | 86.92% |
CHEMBL2095194 | P08709 | Coagulation factor VII/tissue factor | 83.26% | 99.17% |
CHEMBL5888 | Q99558 | Mitogen-activated protein kinase kinase kinase 14 | 83.18% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.98% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.23% | 100.00% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.22% | 92.62% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 81.62% | 91.07% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.20% | 95.89% |
CHEMBL4618 | P09960 | Leukotriene A4 hydrolase | 80.52% | 97.86% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 80.21% | 97.50% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.19% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Allium macleanii |
PubChem | 101931847 |
LOTUS | LTS0116247 |
wikiData | Q105155944 |