(1R,2S,3S,5R,10R)-5-ethenyl-3,8-dihydroxy-2,5,11,11-tetramethyl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-7-en-9-one
| Internal ID | fc548853-f6d7-4069-ada6-dd049fbe8598 |
| Taxonomy | Organoheterocyclic compounds > Oxepanes |
| IUPAC Name | (1R,2S,3S,5R,10R)-5-ethenyl-3,8-dihydroxy-2,5,11,11-tetramethyl-15-oxatetracyclo[8.4.1.01,10.02,7]pentadec-7-en-9-one |
| SMILES (Canonical) | CC1(CCCC23C1(O2)C(=O)C(=C4C3(C(CC(C4)(C)C=C)O)C)O)C |
| SMILES (Isomeric) | C[C@@]1(C[C@@H]([C@@]2(C(=C(C(=O)[C@@]34[C@@]2(O3)CCCC4(C)C)O)C1)C)O)C=C |
| InChI | InChI=1S/C20H28O4/c1-6-17(4)10-12-14(22)15(23)20-16(2,3)8-7-9-19(20,24-20)18(12,5)13(21)11-17/h6,13,21-22H,1,7-11H2,2-5H3/t13-,17+,18-,19+,20+/m0/s1 |
| InChI Key | RYOGLUPEMNUZFR-MMCWTAFCSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.19875937 g/mol |
| Topological Polar Surface Area (TPSA) | 70.10 Ų |
| XlogP | 3.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.64% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.22% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.99% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 89.93% | 94.75% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.91% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.28% | 98.95% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.01% | 100.00% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 85.79% | 91.07% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.38% | 99.23% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 84.10% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.09% | 96.09% |
| CHEMBL4530 | P00488 | Coagulation factor XIII | 83.43% | 96.00% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.89% | 93.04% |
| CHEMBL1902 | P62942 | FK506-binding protein 1A | 81.48% | 97.05% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 80.49% | 97.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vellozia candida |
| PubChem | 163044903 |
| LOTUS | LTS0058826 |
| wikiData | Q105247727 |