[4,5-Dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate
Internal ID | 6332aff8-7471-4d6e-bc1f-b1e5f1b1be95 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Coumaric acids and derivatives |
IUPAC Name | [4,5-dihydroxy-2-[[2-(hydroxymethyl)-10-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-3,9-dioxatricyclo[4.4.0.02,4]dec-7-en-5-yl]oxy]-6-methyloxan-3-yl] 3-(3,4-dihydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)O)O)O)O |
SMILES (Isomeric) | CC1C(C(C(C(O1)OC2C3C=COC(C3C4(C2O4)CO)OC5C(C(C(C(O5)CO)O)O)O)OC(=O)C=CC6=CC(=C(C=C6)O)O)O)O |
InChI | InChI=1S/C30H38O17/c1-11-19(36)22(39)25(44-17(35)5-3-12-2-4-14(33)15(34)8-12)29(42-11)45-24-13-6-7-41-27(18(13)30(10-32)26(24)47-30)46-28-23(40)21(38)20(37)16(9-31)43-28/h2-8,11,13,16,18-29,31-34,36-40H,9-10H2,1H3 |
InChI Key | DZJHQAIWIGSEOY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C30H38O17 |
Molecular Weight | 670.60 g/mol |
Exact Mass | 670.21089974 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | -2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.87% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 99.58% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 97.84% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 97.08% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.97% | 95.56% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.11% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.03% | 96.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 91.75% | 80.78% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.31% | 94.73% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 91.14% | 97.36% |
CHEMBL4208 | P20618 | Proteasome component C5 | 88.86% | 90.00% |
CHEMBL3194 | P02766 | Transthyretin | 88.03% | 90.71% |
CHEMBL2581 | P07339 | Cathepsin D | 87.05% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.95% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.06% | 94.45% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.97% | 86.92% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 80.55% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Premna odorata |
Verbascum thapsus |
PubChem | 72729193 |
LOTUS | LTS0236802 |
wikiData | Q104991832 |