2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-8-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]chromen-4-one
Internal ID | 33e04fb9-fd52-42d4-85d6-152db671d80f |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavonoid glycosides > Flavonoid C-glycosides > Flavonoid 8-C-glycosides |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-8-[(2S,3R,4R,5S)-3,4,5-trihydroxyoxan-2-yl]chromen-4-one |
SMILES (Canonical) | C1C(C(C(C(O1)C2=C3C(=C(C(=C2O)C4C(C(C(C(O4)CO)O)O)O)O)C(=O)C=C(O3)C5=CC(=C(C=C5)O)O)O)O)O |
SMILES (Isomeric) | C1[C@@H]([C@H]([C@H]([C@@H](O1)C2=C3C(=C(C(=C2O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C(=O)C=C(O3)C5=CC(=C(C=C5)O)O)O)O)O |
InChI | InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)15-19(34)14-10(30)4-12(7-1-2-8(28)9(29)3-7)40-24(14)16(20(15)35)25-22(37)17(32)11(31)6-39-25/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2/t11-,13+,17+,18+,21-,22+,23+,25-,26-/m0/s1 |
InChI Key | XBGYTZHKGMCEGE-RJKGXTLSSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H28O15 |
Molecular Weight | 580.50 g/mol |
Exact Mass | 580.14282018 g/mol |
Topological Polar Surface Area (TPSA) | 267.00 Ų |
XlogP | -2.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.87% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.29% | 98.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 96.24% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 92.97% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.65% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.99% | 94.00% |
CHEMBL5284 | Q96RR4 | CaM-kinase kinase beta | 89.75% | 89.23% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.86% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 88.04% | 95.83% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.63% | 94.73% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.27% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.01% | 86.33% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 85.87% | 86.92% |
CHEMBL1075162 | Q13304 | Uracil nucleotide/cysteinyl leukotriene receptor | 83.14% | 80.33% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.04% | 94.45% |
CHEMBL220 | P22303 | Acetylcholinesterase | 81.76% | 94.45% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 81.64% | 85.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Capsicum annuum |
Catananche caerulea |
Hordeum vulgare |
PubChem | 161663063 |
LOTUS | LTS0215349 |
wikiData | Q105324469 |