(1R,2S,4S,6S,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-10-one
Internal ID | 7b88c85c-b189-4d42-b84e-3361d511b788 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (1R,2S,4S,6S,7S,8R,9S,12S,13R,16S)-16-[(2R,3R,4R,5R,6R)-3,4-dihydroxy-6-methyl-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-6-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-18-en-10-one |
SMILES (Canonical) | CC1C2C(CC3C2(C(=O)CC4C3CC=C5C4(CCC(C5)OC6C(C(C(C(O6)C)OC7C(C(C(C(O7)CO)O)O)O)O)O)C)C)OC1(CCC(C)COC8C(C(C(C(O8)CO)O)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@H]2[C@H](C[C@@H]3[C@@]2(C(=O)C[C@H]4[C@H]3CC=C5[C@@]4(CC[C@@H](C5)O[C@H]6[C@@H]([C@H]([C@H]([C@H](O6)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)C)C)O[C@]1(CC[C@@H](C)CO[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O)O |
InChI | InChI=1S/C45H72O19/c1-18(17-58-40-36(54)33(51)31(49)27(15-46)61-40)8-11-45(57)19(2)30-26(64-45)13-25-23-7-6-21-12-22(9-10-43(21,4)24(23)14-29(48)44(25,30)5)60-41-38(56)35(53)39(20(3)59-41)63-42-37(55)34(52)32(50)28(16-47)62-42/h6,18-20,22-28,30-42,46-47,49-57H,7-17H2,1-5H3/t18-,19+,20-,22+,23-,24+,25+,26+,27-,28-,30+,31-,32-,33+,34+,35-,36-,37-,38-,39+,40-,41+,42+,43+,44-,45+/m1/s1 |
InChI Key | YEPLHFBCHYIXDM-VTDRCPNGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C45H72O19 |
Molecular Weight | 917.00 g/mol |
Exact Mass | 916.46678006 g/mol |
Topological Polar Surface Area (TPSA) | 304.00 Ų |
XlogP | -1.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.87% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.72% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.25% | 94.75% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 93.95% | 95.93% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.22% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 93.20% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.83% | 86.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 91.24% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.74% | 93.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.82% | 89.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.53% | 95.89% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 86.90% | 97.25% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 86.09% | 91.71% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.80% | 94.45% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 85.17% | 98.46% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.07% | 95.56% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.67% | 94.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.84% | 92.50% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 82.12% | 100.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 81.55% | 94.73% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.45% | 93.04% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.33% | 99.23% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 80.92% | 97.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.50% | 95.89% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 80.46% | 93.18% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 80.09% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Polygonatum kingianum |
PubChem | 162919578 |
LOTUS | LTS0187852 |
wikiData | Q105347349 |