[(1S,2R,3R,4aS,5R,7R,8aS)-2,7-dihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] (Z)-2-methylbut-2-enoate
| Internal ID | 8a49f2be-fbda-4f14-b49c-f0fed7b24324 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Eremophilane, 8,9-secoeremophilane and furoeremophilane sesquiterpenoids |
| IUPAC Name | [(1S,2R,3R,4aS,5R,7R,8aS)-2,7-dihydroxy-4a,5-dimethyl-3-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydro-1H-naphthalen-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES (Canonical) | CC=C(C)C(=O)OC1C2CC(CC(C2(CC(C1O)C(=C)C)C)C)O |
| SMILES (Isomeric) | C/C=C(/C)\C(=O)O[C@H]1[C@H]2C[C@@H](C[C@H]([C@@]2(C[C@@H]([C@H]1O)C(=C)C)C)C)O |
| InChI | InChI=1S/C20H32O4/c1-7-12(4)19(23)24-18-16-9-14(21)8-13(5)20(16,6)10-15(11(2)3)17(18)22/h7,13-18,21-22H,2,8-10H2,1,3-6H3/b12-7-/t13-,14-,15-,16-,17-,18+,20+/m1/s1 |
| InChI Key | KSHIKWOUQJRNSY-LZQHCKPISA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.23005950 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.03% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.31% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.09% | 97.25% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.90% | 94.45% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 90.02% | 90.17% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 89.70% | 96.77% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.89% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.67% | 89.00% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 85.61% | 96.61% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 84.97% | 91.07% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 84.88% | 96.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.43% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.18% | 100.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.73% | 92.94% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.13% | 96.43% |
| CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 81.87% | 82.69% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.82% | 86.33% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.77% | 92.50% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.66% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Euryops rupestris |
| Mimosa pudica |
| PubChem | 163011879 |
| LOTUS | LTS0091009 |
| wikiData | Q105032296 |