5,6,9,10,11-Pentamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaen-4-ol
| Internal ID | 6329cd03-a2ce-4cb1-841c-4ae599502c05 |
| Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
| IUPAC Name | 5,6,9,10,11-pentamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaen-4-ol |
| SMILES (Canonical) | CC1C(C2C3=CC(=C(C(=C3C4=C(C(=C(C=C4C1O2)O)OC)OC)OC)OC)OC)C |
| SMILES (Isomeric) | CC1C(C2C3=CC(=C(C(=C3C4=C(C(=C(C=C4C1O2)O)OC)OC)OC)OC)OC)C |
| InChI | InChI=1S/C23H28O7/c1-10-11(2)19-13-9-15(25-3)21(27-5)23(29-7)17(13)16-12(18(10)30-19)8-14(24)20(26-4)22(16)28-6/h8-11,18-19,24H,1-7H3 |
| InChI Key | WNZPXAXGHBMGPR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.18350323 g/mol |
| Topological Polar Surface Area (TPSA) | 75.60 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 5,6,9,10,11-Pentamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaen-4-ol](https://plantaedb.com/storage/docs/compounds/2023/11/7c5690e0-8678-11ee-b58e-8fb1ca6be0e0.jpg "2D Structure of 5,6,9,10,11-Pentamethoxy-15,16-dimethyl-17-oxatetracyclo[12.2.1.02,7.08,13]heptadeca-2,4,6,8,10,12-hexaen-4-ol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.50% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.26% | 96.09% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.51% | 86.33% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 88.99% | 89.32% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.77% | 99.17% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 83.98% | 96.86% |
| CHEMBL2535 | P11166 | Glucose transporter | 83.26% | 98.75% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.51% | 90.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.49% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.13% | 94.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.04% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 81.39% | 85.14% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.04% | 92.94% |
| CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 80.19% | 94.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Kadsura coccinea |
| PubChem | 163018261 |
| LOTUS | LTS0275566 |
| wikiData | Q105309387 |