2-[4,5-Dihydroxy-2-[[3-hydroxy-6-methoxy-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | e0a1fd24-5ff2-4ba6-9145-615d1d8143d1 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | 2-[4,5-dihydroxy-2-[[3-hydroxy-6-methoxy-7,9,13-trimethyl-6-(3-methylbutyl)-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosan-16-yl]oxy]-6-(hydroxymethyl)oxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | CC1C2C(C(C3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)O)OC1(CCC(C)C)OC |
SMILES (Isomeric) | CC1C2C(C(C3C2(CCC4C3CCC5C4(CCC(C5)OC6C(C(C(C(O6)CO)O)O)OC7C(C(C(C(O7)CO)O)O)O)C)C)O)OC1(CCC(C)C)OC |
InChI | InChI=1S/C40H68O14/c1-18(2)9-14-40(49-6)19(3)26-34(54-40)30(45)27-22-8-7-20-15-21(10-12-38(20,4)23(22)11-13-39(26,27)5)50-37-35(32(47)29(44)25(17-42)52-37)53-36-33(48)31(46)28(43)24(16-41)51-36/h18-37,41-48H,7-17H2,1-6H3 |
InChI Key | IHMGCJXHLUVQOY-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C40H68O14 |
Molecular Weight | 773.00 g/mol |
Exact Mass | 772.46090684 g/mol |
Topological Polar Surface Area (TPSA) | 217.00 Ų |
XlogP | 3.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.11% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.71% | 91.11% |
CHEMBL237 | P41145 | Kappa opioid receptor | 96.64% | 98.10% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.04% | 97.09% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 94.84% | 97.25% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 94.28% | 98.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.97% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.42% | 96.61% |
CHEMBL233 | P35372 | Mu opioid receptor | 90.43% | 97.93% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 90.37% | 89.05% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.83% | 100.00% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 89.75% | 95.58% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 88.99% | 95.89% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 88.43% | 96.21% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 88.28% | 97.79% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 87.02% | 96.47% |
CHEMBL1871 | P10275 | Androgen Receptor | 86.65% | 96.43% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 86.39% | 92.86% |
CHEMBL2534 | O15530 | 3-phosphoinositide dependent protein kinase-1 | 85.60% | 95.36% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 85.39% | 93.18% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.13% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 83.74% | 95.93% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.41% | 93.56% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 83.21% | 97.33% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 81.98% | 97.29% |
CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 81.56% | 95.50% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.39% | 100.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.21% | 96.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.11% | 98.46% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.66% | 97.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.44% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Anemarrhena asphodeloides |
PubChem | 9853692 |
LOTUS | LTS0090427 |
wikiData | Q105113125 |