(7bR,10aR)-2,3,4,7b,8,9,10,10a-Octahydro-1H-cyclopenta[b][1,4]diazepino[6,7,1-hi]indole
Internal ID | 08c7e4f5-80d3-433a-b443-a3a867da93e0 |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Indolines > 2,3-Cyclopentanoindolines |
IUPAC Name | (11R,15R)-7,10-diazatetracyclo[8.5.1.05,16.011,15]hexadeca-1,3,5(16)-triene |
SMILES (Canonical) | C1CC2C(C1)N3CCNCC4=C3C2=CC=C4 |
SMILES (Isomeric) | C1C[C@H]2[C@@H](C1)N3CCNCC4=C3C2=CC=C4 |
InChI | InChI=1S/C14H18N2/c1-3-10-9-15-7-8-16-13-6-2-4-11(13)12(5-1)14(10)16/h1,3,5,11,13,15H,2,4,6-9H2/t11-,13-/m1/s1 |
InChI Key | XOSKJKGKWRIMGV-DGCLKSJQSA-N |
Popularity | 28 references in papers |
Molecular Formula | C14H18N2 |
Molecular Weight | 214.31 g/mol |
Exact Mass | 214.146998583 g/mol |
Topological Polar Surface Area (TPSA) | 15.30 Ų |
XlogP | 1.90 |
Atomic LogP (AlogP) | 2.25 |
H-Bond Acceptor | 2 |
H-Bond Donor | 1 |
Rotatable Bonds | 0 |
428868-32-0 |
WAY163909 |
WAY 163909 |
MN9LW8268N |
WAY-163,909 |
UNII-MN9LW8268N |
(7bR,10aR)-2,3,4,7b,8,9,10,10a-Octahydro-1H-cyclopenta[b][1,4]diazepino[6,7,1-hi]indole |
CHEMBL1628670 |
(11R,15R)-7,10-diazatetracyclo[8.5.1.0^{5,16}.0^{11,15}]hexadeca-1,3,5(16)-triene |
(7bR,10aR)-2,3,4,7b,8,9,10,10a-Octahydro-1H-cyclopenta(b)(1,4)diazepino(6,7,1-hi)indole |
There are more than 10 synonyms. If you wish to see them all click here. |
![2D Structure of (7bR,10aR)-2,3,4,7b,8,9,10,10a-Octahydro-1H-cyclopenta[b][1,4]diazepino[6,7,1-hi]indole 2D Structure of (7bR,10aR)-2,3,4,7b,8,9,10,10a-Octahydro-1H-cyclopenta[b][1,4]diazepino[6,7,1-hi]indole](https://plantaedb.com/storage/docs/compounds/2023/07/7br10ar-2347b891010a-octahydro-1h-cyclopentab14diazepino671-hiindole.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9946 | 99.46% |
Caco-2 | + | 0.9503 | 95.03% |
Blood Brain Barrier | + | 0.9250 | 92.50% |
Human oral bioavailability | - | 0.5000 | 50.00% |
Subcellular localzation | Lysosomes | 0.7509 | 75.09% |
OATP2B1 inhibitior | - | 0.8592 | 85.92% |
OATP1B1 inhibitior | + | 0.9191 | 91.91% |
OATP1B3 inhibitior | + | 0.9485 | 94.85% |
MATE1 inhibitior | - | 0.9600 | 96.00% |
OCT2 inhibitior | + | 0.6250 | 62.50% |
BSEP inhibitior | - | 0.8002 | 80.02% |
P-glycoprotein inhibitior | - | 0.9697 | 96.97% |
P-glycoprotein substrate | + | 0.5000 | 50.00% |
CYP3A4 substrate | - | 0.5061 | 50.61% |
CYP2C9 substrate | - | 0.6131 | 61.31% |
CYP2D6 substrate | + | 0.6523 | 65.23% |
CYP3A4 inhibition | - | 0.8833 | 88.33% |
CYP2C9 inhibition | - | 0.7475 | 74.75% |
CYP2C19 inhibition | - | 0.6598 | 65.98% |
CYP2D6 inhibition | + | 0.8083 | 80.83% |
CYP1A2 inhibition | + | 0.8554 | 85.54% |
CYP2C8 inhibition | - | 0.8975 | 89.75% |
CYP inhibitory promiscuity | + | 0.5351 | 53.51% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.9200 | 92.00% |
Carcinogenicity (trinary) | Non-required | 0.7373 | 73.73% |
Eye corrosion | - | 0.8558 | 85.58% |
Eye irritation | - | 0.7749 | 77.49% |
Skin irritation | - | 0.5915 | 59.15% |
Skin corrosion | - | 0.6561 | 65.61% |
Ames mutagenesis | - | 0.6100 | 61.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6622 | 66.22% |
Micronuclear | + | 0.6400 | 64.00% |
Hepatotoxicity | + | 0.5856 | 58.56% |
skin sensitisation | - | 0.8718 | 87.18% |
Respiratory toxicity | + | 0.8667 | 86.67% |
Reproductive toxicity | + | 0.7778 | 77.78% |
Mitochondrial toxicity | + | 0.9000 | 90.00% |
Nephrotoxicity | - | 0.6370 | 63.70% |
Acute Oral Toxicity (c) | III | 0.5127 | 51.27% |
Estrogen receptor binding | - | 0.8248 | 82.48% |
Androgen receptor binding | - | 0.5190 | 51.90% |
Thyroid receptor binding | - | 0.6287 | 62.87% |
Glucocorticoid receptor binding | - | 0.8265 | 82.65% |
Aromatase binding | - | 0.7548 | 75.48% |
PPAR gamma | - | 0.5928 | 59.28% |
Honey bee toxicity | - | 0.9282 | 92.82% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | + | 0.6300 | 63.00% |
Fish aquatic toxicity | - | 0.4751 | 47.51% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor |
8 nM 8 nM 8 nM |
EC50 EC50 EC50 |
PMID: 25633969
via Super-PRED PMID: 24491146 |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL228 | P31645 | Serotonin transporter | 97.13% | 95.51% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.52% | 97.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.47% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.64% | 96.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.61% | 95.89% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.90% | 93.99% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.76% | 97.25% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 88.23% | 97.15% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.27% | 95.56% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 86.38% | 88.56% |
CHEMBL238 | Q01959 | Dopamine transporter | 86.28% | 95.88% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 85.46% | 95.83% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 84.23% | 99.18% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 83.29% | 90.71% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 83.07% | 80.71% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 82.86% | 93.03% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 81.93% | 90.24% |
CHEMBL2073 | P07947 | Tyrosine-protein kinase YES | 81.89% | 83.14% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.88% | 93.40% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.80% | 100.00% |
CHEMBL2916 | O14746 | Telomerase reverse transcriptase | 80.91% | 90.00% |
CHEMBL1902 | P62942 | FK506-binding protein 1A | 80.43% | 97.05% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.39% | 94.45% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cannabis sativa |
Piper longum |
Piper nigrum |
PubChem | 10130594 |
NPASS | NPC313673 |
ChEMBL | CHEMBL1628670 |