(7R,10S,13S,19S,22S,25S,28S,29R)-10-[3-(diaminomethylideneamino)propyl]-25-(2-methylpropyl)-9,12,18,21,24,27-hexaoxo-28-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]-22,29-di(propan-2-yl)-2,4,8,11,17,20,23,26,35-nonazahexacyclo[17.16.2.12,5.130,34.013,17.033,36]nonatriaconta-1(36),3,5(39),30(38),31,33-hexaene-7-carboxylic acid
Internal ID | 6bb8b291-b5b4-4df0-b465-2c47d7301760 |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
IUPAC Name | (7R,10S,13S,19S,22S,25S,28S,29R)-10-[3-(diaminomethylideneamino)propyl]-25-(2-methylpropyl)-9,12,18,21,24,27-hexaoxo-28-[[(2S)-5-oxopyrrolidine-2-carbonyl]amino]-22,29-di(propan-2-yl)-2,4,8,11,17,20,23,26,35-nonazahexacyclo[17.16.2.12,5.130,34.013,17.033,36]nonatriaconta-1(36),3,5(39),30(38),31,33-hexaene-7-carboxylic acid |
SMILES (Canonical) | CC(C)CC1C(=O)NC(C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)N1)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)C(NC(=O)C7CCCN7C2=O)CCCN=C(N)N)C(=O)O)N=C6)C(C)C |
SMILES (Isomeric) | CC(C)C[C@H]1C(=O)N[C@H](C(=O)N[C@H]2CC3=C(NC4=C3C=CC(=C4)[C@H]([C@@H](C(=O)N1)NC(=O)[C@@H]5CCC(=O)N5)C(C)C)N6C=C(C[C@@H](NC(=O)[C@@H](NC(=O)[C@@H]7CCCN7C2=O)CCCN=C(N)N)C(=O)O)N=C6)C(C)C |
InChI | InChI=1S/C50H70N14O10/c1-23(2)17-33-44(68)61-39(25(5)6)46(70)59-34-20-29-28-12-11-26(38(24(3)4)40(47(71)58-33)62-43(67)31-13-14-37(65)55-31)18-32(28)56-41(29)63-21-27(54-22-63)19-35(49(73)74)60-42(66)30(9-7-15-53-50(51)52)57-45(69)36-10-8-16-64(36)48(34)72/h11-12,18,21-25,30-31,33-36,38-40,56H,7-10,13-17,19-20H2,1-6H3,(H,55,65)(H,57,69)(H,58,71)(H,59,70)(H,60,66)(H,61,68)(H,62,67)(H,73,74)(H4,51,52,53)/t30-,31-,33-,34-,35+,36-,38+,39-,40-/m0/s1 |
InChI Key | ZIUCJBZUJCNMSJ-NPPMIEIGSA-N |
Popularity | 0 references in papers |
Molecular Formula | C50H70N14O10 |
Molecular Weight | 1027.20 g/mol |
Exact Mass | 1026.53993448 g/mol |
Topological Polar Surface Area (TPSA) | 359.00 Ų |
XlogP | 1.10 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.98% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.81% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.60% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.53% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.53% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 97.76% | 85.14% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.60% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 96.25% | 95.89% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 96.08% | 94.75% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.00% | 90.08% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 95.61% | 90.71% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 94.51% | 92.97% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 94.07% | 95.56% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 92.90% | 97.64% |
CHEMBL2535 | P11166 | Glucose transporter | 92.66% | 98.75% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.56% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 91.84% | 99.17% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 91.71% | 88.56% |
CHEMBL3155 | P34969 | Serotonin 7 (5-HT7) receptor | 91.65% | 90.71% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 89.65% | 90.24% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.60% | 86.33% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 88.55% | 80.71% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.21% | 96.47% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.62% | 89.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 87.48% | 90.24% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.92% | 99.23% |
CHEMBL1628481 | P35414 | Apelin receptor | 85.15% | 97.89% |
CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 83.70% | 97.31% |
CHEMBL3430907 | Q96GD4 | Aurora kinase B/Inner centromere protein | 83.57% | 97.50% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 83.55% | 91.79% |
CHEMBL1744525 | P43490 | Nicotinamide phosphoribosyltransferase | 83.44% | 96.25% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 82.73% | 99.09% |
CHEMBL5203 | P33316 | dUTP pyrophosphatase | 82.05% | 99.18% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.41% | 100.00% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 81.10% | 97.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea millefolium |
Celosia argentea |
PubChem | 163193849 |
LOTUS | LTS0059802 |
wikiData | Q105192139 |