methyl 5-[(6S,7S,8S,9E,15S)-6,15-dihydroxy-8-methoxyheptadeca-9,16-dien-11,13-diyn-7-yl]oxypentanoate
Internal ID | 37388b8d-e5d1-4617-9e48-39084ec6776c |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols > Long-chain fatty alcohols |
IUPAC Name | methyl 5-[(6S,7S,8S,9E,15S)-6,15-dihydroxy-8-methoxyheptadeca-9,16-dien-11,13-diyn-7-yl]oxypentanoate |
SMILES (Canonical) | CCCCCC(C(C(C=CC#CC#CC(C=C)O)OC)OCCCCC(=O)OC)O |
SMILES (Isomeric) | CCCCC[C@@H]([C@@H]([C@H](/C=C/C#CC#C[C@H](C=C)O)OC)OCCCCC(=O)OC)O |
InChI | InChI=1S/C24H36O6/c1-5-7-10-16-21(26)24(30-19-14-13-18-23(27)29-4)22(28-3)17-12-9-8-11-15-20(25)6-2/h6,12,17,20-22,24-26H,2,5,7,10,13-14,16,18-19H2,1,3-4H3/b17-12+/t20-,21-,22-,24-/m0/s1 |
InChI Key | LCCGCXCFZHBCJT-TUAHSIHMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C24H36O6 |
Molecular Weight | 420.50 g/mol |
Exact Mass | 420.25118886 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 3.50 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 98.25% | 99.17% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 95.99% | 97.29% |
CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 95.95% | 85.94% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.39% | 98.95% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 91.18% | 100.00% |
CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 91.02% | 95.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.53% | 91.11% |
CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 89.60% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 89.31% | 93.56% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 89.09% | 92.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 88.79% | 96.00% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 88.19% | 91.19% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 87.40% | 89.34% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 87.04% | 92.86% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 86.00% | 91.24% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 85.82% | 100.00% |
CHEMBL256 | P0DMS8 | Adenosine A3 receptor | 85.38% | 95.93% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 85.32% | 96.47% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 84.55% | 94.33% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 83.96% | 92.50% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 83.24% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 82.26% | 94.45% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.98% | 100.00% |
CHEMBL3267 | P48736 | PI3-kinase p110-gamma subunit | 81.75% | 95.71% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.74% | 90.71% |
CHEMBL1907 | P15144 | Aminopeptidase N | 81.72% | 93.31% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 81.25% | 97.25% |
CHEMBL3401 | O75469 | Pregnane X receptor | 80.52% | 94.73% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Centella asiatica |
PubChem | 163077828 |
LOTUS | LTS0092213 |
wikiData | Q105149767 |