7alpha-Hydroxystigmasterol
Internal ID | 23a2be5c-2c57-4729-a3c3-5c8b4ed3258e |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives |
IUPAC Name | (3S,7S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
SMILES (Canonical) | CCC(C=CC(C)C1CCC2C1(CCC3C2C(C=C4C3(CCC(C4)O)C)O)C)C(C)C |
SMILES (Isomeric) | CC[C@H](/C=C/[C@@H](C)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2[C@@H](C=C4[C@@]3(CC[C@@H](C4)O)C)O)C)C(C)C |
InChI | InChI=1S/C29H48O2/c1-7-20(18(2)3)9-8-19(4)23-10-11-24-27-25(13-15-29(23,24)6)28(5)14-12-22(30)16-21(28)17-26(27)31/h8-9,17-20,22-27,30-31H,7,10-16H2,1-6H3/b9-8+/t19-,20-,22+,23-,24+,25+,26-,27+,28+,29-/m1/s1 |
InChI Key | DPNNWDOFSGOYEK-KQASBSEXSA-N |
Popularity | 0 references in papers |
Molecular Formula | C29H48O2 |
Molecular Weight | 428.70 g/mol |
Exact Mass | 428.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 40.50 Ų |
XlogP | 7.40 |
64998-19-2 |
(3S,7S,8S,9S,10R,13R,14S,17R)-17-[(E,2R,5S)-5-ethyl-6-methylhept-3-en-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,7-diol |
AKOS040761256 |
FS-8921 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.00% | 96.09% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.81% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 94.83% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.22% | 97.25% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.17% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.05% | 91.11% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 90.84% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.53% | 94.45% |
CHEMBL236 | P41143 | Delta opioid receptor | 90.12% | 99.35% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 89.76% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 89.06% | 90.71% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.95% | 97.09% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 85.62% | 94.66% |
CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 84.38% | 92.86% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 84.32% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 82.88% | 93.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 82.67% | 93.04% |
CHEMBL237 | P41145 | Kappa opioid receptor | 82.42% | 98.10% |
CHEMBL4224 | P49759 | Dual specificty protein kinase CLK1 | 82.41% | 85.30% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 82.01% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.28% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artabotrys hexapetalus |
Crepidiastrum denticulatum subsp. denticulatum |
Duhaldea cappa |
Euphorbia fischeriana |
Gynura japonica |
Joannesia princeps |
Leucas cephalotes |
Sphagneticola trilobata |
PubChem | 21769896 |
LOTUS | LTS0162005 |
wikiData | Q104986611 |