(2Z,4E)-5-[(1R,6R)-1-hydroxy-2,6-dimethyl-4-oxo-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid
| Internal ID | 69e32e47-84c4-41e3-b14e-1a1b7f6a52d1 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids > Abscisic acids and derivatives |
| IUPAC Name | (2Z,4E)-5-[(1R,6R)-1-hydroxy-2,6-dimethyl-4-oxo-6-[[(2R,3S,4S,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]cyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES (Canonical) | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)COC2C(C(C(C(O2)CO)O)O)O |
| SMILES (Isomeric) | CC1=CC(=O)C[C@]([C@]1(/C=C/C(=C\C(=O)O)/C)O)(C)CO[C@H]2[C@H]([C@H]([C@H]([C@@H](O2)CO)O)O)O |
| InChI | InChI=1S/C21H30O10/c1-11(6-15(24)25)4-5-21(29)12(2)7-13(23)8-20(21,3)10-30-19-18(28)17(27)16(26)14(9-22)31-19/h4-7,14,16-19,22,26-29H,8-10H2,1-3H3,(H,24,25)/b5-4+,11-6-/t14-,16-,17-,18-,19+,20+,21+/m0/s1 |
| InChI Key | NDFUYJPVVCJYNZ-HTDBADMHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H30O10 |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.18389715 g/mol |
| Topological Polar Surface Area (TPSA) | 174.00 Ų |
| XlogP | -1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.91% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.90% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 91.79% | 89.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.30% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.08% | 86.33% |
| CHEMBL220 | P22303 | Acetylcholinesterase | 89.96% | 94.45% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.73% | 98.95% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.62% | 97.09% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 85.27% | 92.50% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.85% | 96.00% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.42% | 100.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.82% | 95.50% |
| CHEMBL1870 | P28702 | Retinoid X receptor beta | 82.16% | 95.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.49% | 99.23% |
| CHEMBL5028 | O14672 | ADAM10 | 80.58% | 97.50% |
| CHEMBL2061 | P19793 | Retinoid X receptor alpha | 80.56% | 91.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Persea americana |
| PubChem | 162918722 |
| LOTUS | LTS0008441 |
| wikiData | Q105177519 |