(2S,3R,4S,5R,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol
Internal ID | 39d340fd-e940-4e82-8349-40b2b0eecf2a |
Taxonomy | Lignans, neolignans and related compounds > Lignan glycosides |
IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
SMILES (Canonical) | COC1=C(C=CC(=C1)C2C3COC(C3CO2)C4=CC(=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)OC)O |
SMILES (Isomeric) | COC1=C(C=CC(=C1)[C@@H]2[C@H]3CO[C@@H]([C@H]3CO2)C4=CC(=C(C=C4)O[C@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O)OC)O |
InChI | InChI=1S/C26H32O11/c1-32-18-7-12(3-5-16(18)28)24-14-10-35-25(15(14)11-34-24)13-4-6-17(19(8-13)33-2)36-26-23(31)22(30)21(29)20(9-27)37-26/h3-8,14-15,20-31H,9-11H2,1-2H3/t14-,15-,20+,21-,22-,23+,24+,25+,26+/m0/s1 |
InChI Key | QLJNETOQFQXTLI-KVDMYVNUSA-N |
Popularity | 7 references in papers |
Molecular Formula | C26H32O11 |
Molecular Weight | 520.50 g/mol |
Exact Mass | 520.19446183 g/mol |
Topological Polar Surface Area (TPSA) | 157.00 Ų |
XlogP | 0.50 |
There are no found synonyms. |
![2D Structure of (2S,3R,4S,5R,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol 2D Structure of (2S,3R,4S,5R,6R)-2-[4-[(3S,3aR,6S,6aR)-3-(4-hydroxy-3-methoxyphenyl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol](https://plantaedb.com/storage/docs/compounds/2023/11/7a9ff780-8542-11ee-b3af-07bc1b5f2cc9.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.90% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.56% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.18% | 97.09% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 92.30% | 92.94% |
CHEMBL2581 | P07339 | Cathepsin D | 89.66% | 98.95% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.32% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.62% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.45% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.28% | 85.14% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.09% | 94.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 87.56% | 91.49% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.73% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.51% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 84.30% | 90.00% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.02% | 96.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.70% | 86.92% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.40% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.65% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 80.32% | 97.14% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Achillea alexandri-regis |
Baccharis dracunculifolia |
Saussurea medusa |
Tinospora sinensis |
PubChem | 162958742 |
LOTUS | LTS0209992 |
wikiData | Q105223628 |