methyl (1R,4aS,6R,7S,7aR)-4a,7-dihydroxy-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-7-methyl-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate
Internal ID | a00a24ce-9787-46c7-a788-7e17c1e0e65c |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Iridoid O-glycosides |
IUPAC Name | methyl (1R,4aS,6R,7S,7aR)-4a,7-dihydroxy-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-7-methyl-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate |
SMILES (Canonical) | CC1(C(CC2(C1C(OC=C2C(=O)OC)OC3C(C(C(C(O3)CO)O)O)O)O)OC(=O)C=CC4=CC=C(C=C4)O)O |
SMILES (Isomeric) | C[C@]1([C@@H](C[C@@]2([C@H]1[C@H](OC=C2C(=O)OC)O[C@@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)O)O)OC(=O)/C=C/C4=CC=C(C=C4)O)O |
InChI | InChI=1S/C26H32O14/c1-25(34)16(39-17(29)8-5-12-3-6-13(28)7-4-12)9-26(35)14(22(33)36-2)11-37-24(21(25)26)40-23-20(32)19(31)18(30)15(10-27)38-23/h3-8,11,15-16,18-21,23-24,27-28,30-32,34-35H,9-10H2,1-2H3/b8-5+/t15-,16+,18-,19+,20-,21-,23+,24+,25+,26+/m0/s1 |
InChI Key | NQXDDVZOWBZZHN-JHRNXWKOSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H32O14 |
Molecular Weight | 568.50 g/mol |
Exact Mass | 568.17920569 g/mol |
Topological Polar Surface Area (TPSA) | 222.00 Ų |
XlogP | -0.80 |
64597-22-4 |
![2D Structure of methyl (1R,4aS,6R,7S,7aR)-4a,7-dihydroxy-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-7-methyl-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate 2D Structure of methyl (1R,4aS,6R,7S,7aR)-4a,7-dihydroxy-6-[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]oxy-7-methyl-1-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,5,6,7a-tetrahydrocyclopenta[c]pyran-4-carboxylate](https://plantaedb.com/storage/docs/compounds/2023/11/79f45f40-85f2-11ee-9544-7ff30bf887b1.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.55% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.35% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 95.71% | 86.33% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.05% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.73% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.02% | 89.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 90.89% | 97.09% |
CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 88.69% | 97.28% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.45% | 99.17% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 86.18% | 89.67% |
CHEMBL2581 | P07339 | Cathepsin D | 85.50% | 98.95% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.04% | 95.89% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.60% | 94.73% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.39% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 83.59% | 95.56% |
CHEMBL2111367 | P27986 | PI3-kinase p110-alpha/p85-alpha | 81.84% | 94.33% |
CHEMBL5678 | P34947 | G protein-coupled receptor kinase 5 | 81.77% | 88.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.68% | 95.89% |
CHEMBL4208 | P20618 | Proteasome component C5 | 81.32% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Bouchea pseudogervao |
Citharexylum spinosum |
Duranta erecta |
PubChem | 133556257 |
LOTUS | LTS0153411 |
wikiData | Q104403653 |