7,8,9-Trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-2-carboxylic acid
Internal ID | 661e3685-a8f5-41eb-84cd-00ceebb37cdc |
Taxonomy | Phenylpropanoids and polyketides > Isocoumarins and derivatives |
IUPAC Name | 7,8,9-trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-2-carboxylic acid |
SMILES (Canonical) | C1C(C(=O)C2=C1C3=C(C(=C(C=C3C(=O)O2)O)O)O)C(=O)O |
SMILES (Isomeric) | C1C(C(=O)C2=C1C3=C(C(=C(C=C3C(=O)O2)O)O)O)C(=O)O |
InChI | InChI=1S/C13H8O8/c14-6-2-4-7(10(17)9(6)16)3-1-5(12(18)19)8(15)11(3)21-13(4)20/h2,5,14,16-17H,1H2,(H,18,19) |
InChI Key | APOYITXPNFORST-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C13H8O8 |
Molecular Weight | 292.20 g/mol |
Exact Mass | 292.02191721 g/mol |
Topological Polar Surface Area (TPSA) | 141.00 Ų |
XlogP | 0.70 |
BDBM50487950 |
![2D Structure of 7,8,9-Trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-2-carboxylic acid 2D Structure of 7,8,9-Trihydroxy-3,5-dioxo-1,2-dihydrocyclopenta[c]isochromene-2-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/789-trihydroxy-35-dioxo-12-dihydrocyclopentacisochromene-2-carboxylic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.68% | 91.11% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.26% | 89.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.85% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.72% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 90.61% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 86.37% | 98.95% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 84.96% | 95.62% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.37% | 94.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.78% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.92% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 81.12% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 80.83% | 99.15% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus niruri |
PubChem | 76333823 |
LOTUS | LTS0080368 |
wikiData | Q104916460 |