(2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[[(1R,2S,3R,4R,8S,9S,12S,13R,16S)-3-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol
Internal ID | 343a73c7-b8bc-4d0a-acae-18abc2f25c43 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides > Steroidal saponins |
IUPAC Name | (2S,3R,4R,5R,6S)-2-[(2R,3S,4S,5R,6R)-4-hydroxy-2-(hydroxymethyl)-6-[[(1R,2S,3R,4R,8S,9S,12S,13R,16S)-3-hydroxy-7,9,13-trimethyl-6-[(3R)-3-methyl-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybutyl]-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-6,18-dien-16-yl]oxy]-5-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-3-yl]oxy-6-methyloxane-3,4,5-triol |
SMILES (Canonical) | CC1C(C(C(C(O1)OC2C(OC(C(C2O)OC3C(C(C(C(O3)C)O)O)O)OC4CCC5(C6CCC7(C(C6CC=C5C4)C(C8C7C(=C(O8)CCC(C)COC9C(C(C(C(O9)CO)O)O)O)C)O)C)C)CO)O)O)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O[C@H]3[C@@H]([C@@H]([C@H]([C@@H](O3)C)O)O)O)O[C@H]4CC[C@@]5([C@H]6CC[C@]7([C@H]([C@@H]6CC=C5C4)[C@H]([C@H]8[C@@H]7C(=C(O8)CC[C@@H](C)CO[C@H]9[C@@H]([C@H]([C@@H]([C@H](O9)CO)O)O)O)C)O)C)C)CO)O)O)O |
InChI | InChI=1S/C51H82O22/c1-19(18-65-46-39(61)38(60)34(56)28(16-52)70-46)7-10-27-20(2)30-44(69-27)35(57)31-25-9-8-23-15-24(11-13-50(23,5)26(25)12-14-51(30,31)6)68-49-45(73-48-41(63)37(59)33(55)22(4)67-48)42(64)43(29(17-53)71-49)72-47-40(62)36(58)32(54)21(3)66-47/h8,19,21-22,24-26,28-49,52-64H,7,9-18H2,1-6H3/t19-,21+,22+,24+,25-,26+,28-,29-,30+,31-,32+,33+,34-,35-,36-,37-,38+,39-,40-,41-,42+,43-,44-,45-,46-,47+,48+,49-,50+,51-/m1/s1 |
InChI Key | MRHTVOYNFHEINX-KGCHMFBISA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H82O22 |
Molecular Weight | 1047.20 g/mol |
Exact Mass | 1046.52977424 g/mol |
Topological Polar Surface Area (TPSA) | 346.00 Ų |
XlogP | -2.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.66% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.39% | 91.11% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.07% | 97.25% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 95.47% | 95.93% |
CHEMBL2581 | P07339 | Cathepsin D | 95.04% | 98.95% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 94.64% | 94.75% |
CHEMBL4681 | P42330 | Aldo-keto-reductase family 1 member C3 | 92.88% | 89.05% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.02% | 89.00% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.01% | 96.61% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 90.98% | 95.89% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.93% | 93.56% |
CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 90.38% | 97.36% |
CHEMBL325 | Q13547 | Histone deacetylase 1 | 90.04% | 95.92% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.01% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.70% | 94.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.39% | 97.09% |
CHEMBL3713062 | P10646 | Tissue factor pathway inhibitor | 88.62% | 97.33% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.26% | 100.00% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 87.15% | 90.08% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.22% | 86.33% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.60% | 100.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.59% | 94.45% |
CHEMBL237 | P41145 | Kappa opioid receptor | 85.43% | 98.10% |
CHEMBL233 | P35372 | Mu opioid receptor | 83.95% | 97.93% |
CHEMBL3401 | O75469 | Pregnane X receptor | 83.23% | 94.73% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 82.54% | 97.79% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.24% | 100.00% |
CHEMBL2140 | P48775 | Tryptophan 2,3-dioxygenase | 81.67% | 98.46% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 81.37% | 93.18% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 81.26% | 96.37% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.95% | 96.47% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.91% | 85.00% |
CHEMBL2094135 | Q96BI3 | Gamma-secretase | 80.54% | 98.05% |
CHEMBL2782 | P35610 | Acyl coenzyme A:cholesterol acyltransferase 1 | 80.53% | 91.65% |
CHEMBL5028 | O14672 | ADAM10 | 80.12% | 97.50% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 80.03% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Smilax china |
PubChem | 163002099 |
LOTUS | LTS0163885 |
wikiData | Q105170584 |