7,8-Dehydrorutaecarpine
Internal ID | 1f336783-c0b1-4469-8a98-f7b947c1460e |
Taxonomy | Organoheterocyclic compounds > Indoles and derivatives > Pyridoindoles > Beta carbolines |
IUPAC Name | 3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,11,15,17,19-nonaen-14-one |
SMILES (Canonical) | C1=CC=C2C(=C1)C3=C(N2)C4=NC5=CC=CC=C5C(=O)N4C=C3 |
SMILES (Isomeric) | C1=CC=C2C(=C1)C3=C(N2)C4=NC5=CC=CC=C5C(=O)N4C=C3 |
InChI | InChI=1S/C18H11N3O/c22-18-13-6-2-4-8-15(13)20-17-16-12(9-10-21(17)18)11-5-1-3-7-14(11)19-16/h1-10,19H |
InChI Key | KLONOPPMRIDVGM-UHFFFAOYSA-N |
Popularity | 2 references in papers |
Molecular Formula | C18H11N3O |
Molecular Weight | 285.30 g/mol |
Exact Mass | 285.090211983 g/mol |
Topological Polar Surface Area (TPSA) | 48.50 Ų |
XlogP | 3.10 |
55786-24-8 |
CHEMBL413956 |
CHEMBL4098122 |
SCHEMBL11045540 |
SCHEMBL23226026 |
DTXSID40204348 |
Indolo(2',3':3,4)pyrido(2,1-b)quinazolin-5(13H)-one |
BDBM50131044 |
13H-Indolo[2'',3'':3,4]pyrido[2,1-b]quinazolin-5-one |
3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-1(21),2(10),4,6,8,11,15,17,19-nonaen-14-one |
![2D Structure of 7,8-Dehydrorutaecarpine 2D Structure of 7,8-Dehydrorutaecarpine](https://plantaedb.com/storage/docs/compounds/2023/11/78-dehydrorutaecarpine.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
CHEMBL4878 | Q16678 | Cytochrome P450 1B1 |
55 nM |
IC50 |
via Super-PRED
|
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL1951 | P21397 | Monoamine oxidase A | 96.14% | 91.49% |
CHEMBL2581 | P07339 | Cathepsin D | 95.61% | 98.95% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 94.01% | 94.62% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 93.25% | 97.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 92.98% | 99.23% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 90.89% | 93.40% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 89.75% | 85.14% |
CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 88.25% | 92.67% |
CHEMBL2094121 | P14867 | GABA-A receptor; alpha-1/beta-3/gamma-2 | 86.98% | 95.50% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 86.45% | 95.56% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.41% | 94.75% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 85.27% | 94.23% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 84.74% | 98.59% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.35% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.18% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.67% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.83% | 89.00% |
CHEMBL4302 | P08183 | P-glycoprotein 1 | 80.86% | 92.98% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.85% | 91.71% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 80.58% | 91.11% |
CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 80.36% | 96.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phellodendron amurense |
PubChem | 148756 |
LOTUS | LTS0241483 |
wikiData | Q83077791 |