(3aR,4aS,8aR,8bS)-4a-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]-1,2,3a,8,8a,8b-hexahydro-[1]benzofuro[2,3-b]pyrrol-7-one
Internal ID | d11ef749-af62-4cee-81ae-c8c7c592b79f |
Taxonomy | Organoheterocyclic compounds > Pyrrolidines > Phenylpyrrolidines |
IUPAC Name | (3aR,4aS,8aR,8bS)-4a-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]-3-[4-[2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethyl]phenyl]-1,2,3a,8,8a,8b-hexahydro-[1]benzofuro[2,3-b]pyrrol-7-one |
SMILES (Canonical) | C1CN(C2C1C3CC(=O)C=CC3(O2)CCOC4C(C(C(C(O4)CO)O)O)O)C5=CC=C(C=C5)CCOC6C(C(C(C(O6)CO)O)O)O |
SMILES (Isomeric) | C1CN([C@H]2[C@@H]1[C@H]3CC(=O)C=C[C@@]3(O2)CCO[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)C5=CC=C(C=C5)CCO[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O |
InChI | InChI=1S/C32H45NO14/c34-14-21-23(37)25(39)27(41)30(45-21)43-11-7-16-1-3-17(4-2-16)33-10-6-19-20-13-18(36)5-8-32(20,47-29(19)33)9-12-44-31-28(42)26(40)24(38)22(15-35)46-31/h1-5,8,19-31,34-35,37-42H,6-7,9-15H2/t19-,20+,21+,22+,23+,24+,25-,26-,27+,28+,29+,30+,31+,32+/m0/s1 |
InChI Key | QCBWMDCBFUJLKV-PBKFSEAISA-N |
Popularity | 0 references in papers |
Molecular Formula | C32H45NO14 |
Molecular Weight | 667.70 g/mol |
Exact Mass | 667.28400511 g/mol |
Topological Polar Surface Area (TPSA) | 228.00 Ų |
XlogP | -1.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.74% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.99% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 96.42% | 98.95% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.49% | 97.25% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 92.36% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.26% | 97.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.96% | 94.00% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.11% | 94.62% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.50% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 88.85% | 85.14% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.68% | 94.45% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 88.56% | 96.61% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.91% | 95.56% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.76% | 95.83% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.65% | 86.92% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.00% | 93.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.55% | 89.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.81% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Millingtonia hortensis |
PubChem | 162996641 |
LOTUS | LTS0181758 |
wikiData | Q105218142 |