7,7-Dihydroebuloside
Internal ID | ef16c86c-6e35-4cef-8d44-5dd7cfbd2829 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides |
IUPAC Name | [(1S,4aS,6S,7R,7aS)-6-hydroxy-7-methyl-4-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-yl] 3-methylbutanoate |
SMILES (Canonical) | CC1C(CC2C1C(OC=C2COC3C(C(C(C(O3)CO)O)O)O)OC(=O)CC(C)C)O |
SMILES (Isomeric) | C[C@H]1[C@H](C[C@H]2[C@@H]1[C@@H](OC=C2CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)OC(=O)CC(C)C)O |
InChI | InChI=1S/C21H34O10/c1-9(2)4-15(24)31-20-16-10(3)13(23)5-12(16)11(7-28-20)8-29-21-19(27)18(26)17(25)14(6-22)30-21/h7,9-10,12-14,16-23,25-27H,4-6,8H2,1-3H3/t10-,12+,13-,14+,16+,17+,18-,19+,20-,21+/m0/s1 |
InChI Key | ZUUFVSDKQQQGTN-WLGYPTIJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C21H34O10 |
Molecular Weight | 446.50 g/mol |
Exact Mass | 446.21519728 g/mol |
Topological Polar Surface Area (TPSA) | 155.00 Ų |
XlogP | -0.50 |
SCHEMBL422933 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.68% | 96.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.57% | 91.11% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.13% | 97.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 92.99% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 91.30% | 98.95% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 88.88% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 88.78% | 89.00% |
CHEMBL3401 | O75469 | Pregnane X receptor | 87.85% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.82% | 97.25% |
CHEMBL1293316 | Q9HBX9 | Relaxin receptor 1 | 83.28% | 82.50% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.12% | 86.92% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 81.68% | 95.93% |
CHEMBL3437 | Q16853 | Amine oxidase, copper containing | 81.13% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.69% | 85.14% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.63% | 95.89% |
CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.41% | 97.21% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 80.10% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Penstemon confertus |
Sambucus ebulus |
PubChem | 21587052 |
LOTUS | LTS0087266 |
wikiData | Q105384115 |