(1R,6R,7R,10S,11R,14S,16R,17R,18S)-18-hydroxy-11-(2-hydroxy-5-oxo-2H-furan-4-yl)-6,10,17,20,20-pentamethyl-2,12,15,19-tetraoxahexacyclo[16.2.1.01,6.07,17.010,16.014,16]henicos-4-ene-3,13,21-trione
| Internal ID | e5dffc20-3e46-46b5-8672-dca24feda581 |
| Taxonomy | Organoheterocyclic compounds > Naphthopyrans |
| IUPAC Name | (1R,6R,7R,10S,11R,14S,16R,17R,18S)-18-hydroxy-11-(2-hydroxy-5-oxo-2H-furan-4-yl)-6,10,17,20,20-pentamethyl-2,12,15,19-tetraoxahexacyclo[16.2.1.01,6.07,17.010,16.014,16]henicos-4-ene-3,13,21-trione |
| SMILES (Canonical) | CC1(C23C(=O)C(O1)(C4(C(C2(C=CC(=O)O3)C)CCC5(C46C(O6)C(=O)OC5C7=CC(OC7=O)O)C)C)O)C |
| SMILES (Isomeric) | C[C@@]12CC[C@@H]3[C@]4(C=CC(=O)O[C@]45C(=O)[C@]([C@]3([C@@]16[C@H](O6)C(=O)O[C@H]2C7=CC(OC7=O)O)C)(OC5(C)C)O)C |
| InChI | InChI=1S/C26H28O11/c1-20(2)25-19(31)26(32,37-20)23(5)12(21(25,3)9-7-13(27)35-25)6-8-22(4)15(11-10-14(28)33-17(11)29)34-18(30)16-24(22,23)36-16/h7,9-10,12,14-16,28,32H,6,8H2,1-5H3/t12-,14?,15+,16-,21-,22+,23-,24-,25+,26-/m1/s1 |
| InChI Key | TVHZYNRKUSVTOU-DDEQKIGHSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C26H28O11 |
| Molecular Weight | 516.50 g/mol |
| Exact Mass | 516.16316171 g/mol |
| Topological Polar Surface Area (TPSA) | 158.00 Ų |
| XlogP | 0.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.83% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.92% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.86% | 96.09% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 89.33% | 83.82% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 88.13% | 100.00% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 87.91% | 89.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.06% | 98.95% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.28% | 99.23% |
| CHEMBL3922 | P50579 | Methionine aminopeptidase 2 | 84.71% | 97.28% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 83.43% | 86.92% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 82.77% | 97.25% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.82% | 86.33% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.71% | 95.89% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 80.37% | 93.03% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Harrisonia perforata |
| PubChem | 101681945 |
| LOTUS | LTS0047057 |
| wikiData | Q105265320 |