[(1R,19S,21R,22R,23S)-6,7,8,11,12,13-hexahydroxy-3,16-dioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl] 3,4,5-trihydroxybenzoate
Internal ID | cf09a39c-d0ff-4c63-a3a1-9b954bacd082 |
Taxonomy | Phenylpropanoids and polyketides > Tannins > Hydrolyzable tannins |
IUPAC Name | [(1R,19S,21R,22R,23S)-6,7,8,11,12,13-hexahydroxy-3,16-dioxo-21,22-bis[(3,4,5-trihydroxybenzoyl)oxy]-2,17,20-trioxatetracyclo[17.3.1.04,9.010,15]tricosa-4,6,8,10,12,14-hexaen-23-yl] 3,4,5-trihydroxybenzoate |
SMILES (Canonical) | C1C2C(C(C(C(O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
SMILES (Isomeric) | C1[C@H]2[C@@H]([C@H]([C@H]([C@H](O2)OC(=O)C3=CC(=C(C(=C3)O)O)O)OC(=O)C4=CC(=C(C(=C4)O)O)O)OC(=O)C5=CC(=C(C(=C5C6=C(C(=C(C=C6C(=O)O1)O)O)O)O)O)O)OC(=O)C7=CC(=C(C(=C7)O)O)O |
InChI | InChI=1S/C41H30O26/c42-15-1-10(2-16(43)26(15)50)36(57)64-33-23-9-62-39(60)13-7-21(48)29(53)31(55)24(13)25-14(8-22(49)30(54)32(25)56)40(61)65-34(33)35(66-37(58)11-3-17(44)27(51)18(45)4-11)41(63-23)67-38(59)12-5-19(46)28(52)20(47)6-12/h1-8,23,33-35,41-56H,9H2/t23-,33-,34+,35+,41+/m0/s1 |
InChI Key | DPBVYZVSXAZMAY-GKQBRALESA-N |
Popularity | 0 references in papers |
Molecular Formula | C41H30O26 |
Molecular Weight | 938.70 g/mol |
Exact Mass | 938.10253106 g/mol |
Topological Polar Surface Area (TPSA) | 444.00 Ų |
XlogP | 2.40 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.99% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.82% | 91.49% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.04% | 86.33% |
CHEMBL3475 | P05121 | Plasminogen activator inhibitor-1 | 89.80% | 83.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.70% | 89.00% |
CHEMBL2581 | P07339 | Cathepsin D | 88.34% | 98.95% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 88.07% | 94.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.01% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.81% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 86.22% | 99.23% |
CHEMBL2345 | P51812 | Ribosomal protein S6 kinase alpha 3 | 86.13% | 95.64% |
CHEMBL3401 | O75469 | Pregnane X receptor | 84.39% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.17% | 95.56% |
CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 83.05% | 96.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
CHEMBL3194 | P02766 | Transthyretin | 82.88% | 90.71% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 82.59% | 99.15% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.17% | 97.09% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.12% | 92.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Phyllanthus emblica |
Punica granatum |
PubChem | 157874172 |
LOTUS | LTS0236719 |
wikiData | Q104986401 |