5,7-Dihydroxy-2-[4-hydroxy-3-(2-hydroxy-3-methyl-3-butenyl)phenyl]-6-(2-hydroxy-3-methyl-3-butenyl)-4H-1-benzopyran-4-one
Internal ID | 1ceaaa19-f91e-47d2-a626-b29f5f06949c |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavones > 6-prenylated flavones |
IUPAC Name | 5,7-dihydroxy-2-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]-6-(2-hydroxy-3-methylbut-3-enyl)chromen-4-one |
SMILES (Canonical) | CC(=C)C(CC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)CC(C(=C)C)O)O)O)O |
SMILES (Isomeric) | CC(=C)C(CC1=C(C=CC(=C1)C2=CC(=O)C3=C(O2)C=C(C(=C3O)CC(C(=C)C)O)O)O)O |
InChI | InChI=1S/C25H26O7/c1-12(2)18(27)8-15-7-14(5-6-17(15)26)22-11-21(30)24-23(32-22)10-20(29)16(25(24)31)9-19(28)13(3)4/h5-7,10-11,18-19,26-29,31H,1,3,8-9H2,2,4H3 |
InChI Key | ODSBLPWPWDEDKQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H26O7 |
Molecular Weight | 438.50 g/mol |
Exact Mass | 438.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 127.00 Ų |
XlogP | 4.40 |
CHEBI:187242 |
LMPK12110416 |
5,7-dihydroxy-2-[4-hydroxy-3-(2-hydroxy-3-methylbut-3-enyl)phenyl]-6-(2-hydroxy-3-methylbut-3-enyl)chromen-4-one |
![2D Structure of 5,7-Dihydroxy-2-[4-hydroxy-3-(2-hydroxy-3-methyl-3-butenyl)phenyl]-6-(2-hydroxy-3-methyl-3-butenyl)-4H-1-benzopyran-4-one 2D Structure of 5,7-Dihydroxy-2-[4-hydroxy-3-(2-hydroxy-3-methyl-3-butenyl)phenyl]-6-(2-hydroxy-3-methyl-3-butenyl)-4H-1-benzopyran-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/74aeb7f0-8708-11ee-a14a-b98915065e56.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.62% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 98.98% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.40% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 95.60% | 91.49% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.96% | 89.00% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 94.38% | 99.15% |
CHEMBL3401 | O75469 | Pregnane X receptor | 92.11% | 94.73% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 92.02% | 94.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.34% | 94.45% |
CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 89.61% | 83.57% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 87.18% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.88% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.21% | 95.56% |
CHEMBL3194 | P02766 | Transthyretin | 81.52% | 90.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Vancouveria hexandra |
PubChem | 44257867 |
LOTUS | LTS0168859 |
wikiData | Q105189989 |