(13R)-8,17-dihydroxy-6,19-dimethoxy-14,14-dimethyl-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),4,6,8,16(20),17-heptaen-10-one
Internal ID | d722f0b5-6ea9-4133-a962-db4edc541e62 |
Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Xanthones |
IUPAC Name | (13R)-8,17-dihydroxy-6,19-dimethoxy-14,14-dimethyl-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),4,6,8,16(20),17-heptaen-10-one |
SMILES (Canonical) | CC1(C2CC3=C(C4=C(C=C(C(=C24)O1)O)OC)OC5=CC(=CC(=C5C3=O)O)OC)C |
SMILES (Isomeric) | CC1([C@@H]2CC3=C(C4=C(C=C(C(=C24)O1)O)OC)OC5=CC(=CC(=C5C3=O)O)OC)C |
InChI | InChI=1S/C22H20O7/c1-22(2)11-7-10-19(25)17-12(23)5-9(26-3)6-15(17)28-20(10)18-14(27-4)8-13(24)21(29-22)16(11)18/h5-6,8,11,23-24H,7H2,1-4H3/t11-/m1/s1 |
InChI Key | LDQNIBPJKBVZEF-LLVKDONJSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H20O7 |
Molecular Weight | 396.40 g/mol |
Exact Mass | 396.12090297 g/mol |
Topological Polar Surface Area (TPSA) | 94.40 Ų |
XlogP | 3.40 |
There are no found synonyms. |
![2D Structure of (13R)-8,17-dihydroxy-6,19-dimethoxy-14,14-dimethyl-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),4,6,8,16(20),17-heptaen-10-one 2D Structure of (13R)-8,17-dihydroxy-6,19-dimethoxy-14,14-dimethyl-3,15-dioxapentacyclo[11.6.1.02,11.04,9.016,20]icosa-1(19),2(11),4,6,8,16(20),17-heptaen-10-one](https://plantaedb.com/storage/docs/compounds/2023/11/749b3ee0-8630-11ee-a190-c5868b10032c.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.59% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.19% | 94.45% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 98.00% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 96.11% | 95.56% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.42% | 89.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 94.37% | 94.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.77% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 90.21% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.76% | 97.09% |
CHEMBL4208 | P20618 | Proteasome component C5 | 89.63% | 90.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.72% | 99.23% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.66% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.45% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.60% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.34% | 99.17% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.59% | 95.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 83.32% | 91.19% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.08% | 86.33% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 82.99% | 92.94% |
CHEMBL2535 | P11166 | Glucose transporter | 82.55% | 98.75% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.45% | 92.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus heterophyllus |
PubChem | 154496195 |
LOTUS | LTS0214084 |
wikiData | Q105150329 |