2-Hydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-3-en-1-one
Internal ID | ce918d5c-a733-4c47-8e87-18ccba306a30 |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty acyl glycosides > Fatty acyl glycosides of mono- and disaccharides |
IUPAC Name | 2-hydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-3-en-1-one |
SMILES (Canonical) | CC1=C(C(CC(=O)C1O)(C)C)C=CC(C)OC2C(C(C(C(O2)CO)O)O)O |
SMILES (Isomeric) | CC1=C(C(CC(=O)C1O)(C)C)C=CC(C)OC2C(C(C(C(O2)CO)O)O)O |
InChI | InChI=1S/C19H30O8/c1-9(26-18-17(25)16(24)15(23)13(8-20)27-18)5-6-11-10(2)14(22)12(21)7-19(11,3)4/h5-6,9,13-18,20,22-25H,7-8H2,1-4H3 |
InChI Key | UGEWAWWHOAMOFI-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H30O8 |
Molecular Weight | 386.40 g/mol |
Exact Mass | 386.19406791 g/mol |
Topological Polar Surface Area (TPSA) | 137.00 Ų |
XlogP | -0.90 |
There are no found synonyms. |
![2D Structure of 2-Hydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-3-en-1-one 2D Structure of 2-Hydroxy-3,5,5-trimethyl-4-[3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxybut-1-enyl]cyclohex-3-en-1-one](https://plantaedb.com/storage/docs/compounds/2023/11/747b8a00-8534-11ee-bff4-1d925901fa6a.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.16% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.32% | 96.09% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 92.48% | 94.75% |
CHEMBL2581 | P07339 | Cathepsin D | 90.33% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.16% | 95.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.39% | 96.47% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.76% | 94.73% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.01% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.99% | 97.09% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 84.82% | 96.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 84.59% | 96.21% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.50% | 94.45% |
CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 84.46% | 89.34% |
CHEMBL1907602 | P06493 | Cyclin-dependent kinase 1/cyclin B1 | 83.36% | 91.24% |
CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 83.29% | 96.61% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.96% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.18% | 86.92% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.38% | 93.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.91% | 95.89% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.89% | 95.89% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.41% | 99.17% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.32% | 85.14% |
CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 80.17% | 96.77% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Amaranthus caudatus |
PubChem | 162940809 |
LOTUS | LTS0070821 |
wikiData | Q105272295 |