(S)-(3beta)-28-(beta-D-Glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-[carboxy(carboxymethoxy)methyl]-beta-D-glucopyranosiduronic acid
Internal ID | 2b5e8900-5e99-43fc-ba53-d877cfe4ee3f |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Terpene glycosides > Triterpene glycosides > Triterpene saponins |
IUPAC Name | (2S,3S,4S,5R,6R)-6-[[(3S,4aR,6aR,6bS,8aS,12aS,14aR,14bR)-4,4,6a,6b,11,11,14b-heptamethyl-8a-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycarbonyl-1,2,3,4a,5,6,7,8,9,10,12,12a,14,14a-tetradecahydropicen-3-yl]oxy]-4-[(S)-carboxy(carboxymethoxy)methoxy]-3,5-dihydroxyoxane-2-carboxylic acid |
SMILES (Canonical) | CC1(CCC2(CCC3(C(=CCC4C3(CCC5C4(CCC(C5(C)C)OC6C(C(C(C(O6)C(=O)O)O)OC(C(=O)O)OCC(=O)O)O)C)C)C2C1)C)C(=O)OC7C(C(C(C(O7)CO)O)O)O)C |
SMILES (Isomeric) | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)C)C)(C)C)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O[C@@H](C(=O)O)OCC(=O)O)O |
InChI | InChI=1S/C46H70O19/c1-41(2)14-16-46(40(59)65-37-30(52)29(51)28(50)23(19-47)61-37)17-15-44(6)21(22(46)18-41)8-9-25-43(5)12-11-26(42(3,4)24(43)10-13-45(25,44)7)62-38-32(54)33(31(53)34(64-38)35(55)56)63-39(36(57)58)60-20-27(48)49/h8,22-26,28-34,37-39,47,50-54H,9-20H2,1-7H3,(H,48,49)(H,55,56)(H,57,58)/t22-,23+,24-,25+,26-,28+,29-,30+,31-,32+,33-,34-,37-,38+,39-,43-,44+,45+,46-/m0/s1 |
InChI Key | DVEJWYUSLPQXTD-NCEDLQITSA-N |
Popularity | 0 references in papers |
Molecular Formula | C46H70O19 |
Molecular Weight | 927.00 g/mol |
Exact Mass | 926.45113000 g/mol |
Topological Polar Surface Area (TPSA) | 306.00 Ų |
XlogP | 4.00 |
(S)-(3beta)-28-(beta-D-Glucopyranosyloxy)-28-oxoolean-12-en-3-yl 3-O-[carboxy(carboxymethoxy)methyl]-beta-D-glucopyranosiduronic acid |
182322-57-2 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.66% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.01% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.81% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.72% | 97.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.42% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.11% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.87% | 99.17% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.88% | 90.17% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 84.78% | 93.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 84.73% | 92.50% |
CHEMBL216 | P11229 | Muscarinic acetylcholine receptor M1 | 84.70% | 94.23% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 84.37% | 86.92% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 83.60% | 94.08% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.91% | 95.89% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.57% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.40% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.29% | 89.00% |
CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 80.99% | 96.21% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.27% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Basella alba |
Pisonia umbellifera |
Spinacia oleracea |
PubChem | 100929764 |
LOTUS | LTS0169117 |
wikiData | Q104989938 |