6-Amino-2-[[8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carbonyl]amino]hexanoic acid
Internal ID | 2830dec8-fc62-491e-997a-c142db5c649b |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
IUPAC Name | 6-amino-2-[[8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carbonyl]amino]hexanoic acid |
SMILES (Canonical) | CC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CC2=CN(C(C(=O)N1)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C4CCCN4C(=O)C5CCC(=O)N5)C6=CC=CC=C26)C(=O)NC(CCCCN)C(=O)O)CO)CC7=CC=CC=C7 |
SMILES (Isomeric) | CC(C)C1C(=O)NC(C(=O)NC(C(=O)NC(CC2=CN(C(C(=O)N1)NC(=O)C(CC3=CC=C(C=C3)O)NC(=O)C4CCCN4C(=O)C5CCC(=O)N5)C6=CC=CC=C26)C(=O)NC(CCCCN)C(=O)O)CO)CC7=CC=CC=C7 |
InChI | InChI=1S/C55H69N11O13/c1-30(2)45-52(75)61-38(25-31-11-4-3-5-12-31)47(70)62-41(29-67)50(73)59-40(48(71)58-37(55(78)79)14-8-9-23-56)27-33-28-66(42-15-7-6-13-35(33)42)46(53(76)63-45)64-49(72)39(26-32-17-19-34(68)20-18-32)60-51(74)43-16-10-24-65(43)54(77)36-21-22-44(69)57-36/h3-7,11-13,15,17-20,28,30,36-41,43,45-46,67-68H,8-10,14,16,21-27,29,56H2,1-2H3,(H,57,69)(H,58,71)(H,59,73)(H,60,74)(H,61,75)(H,62,70)(H,63,76)(H,64,72)(H,78,79) |
InChI Key | CARJUOBZMZRPOF-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C55H69N11O13 |
Molecular Weight | 1092.20 g/mol |
Exact Mass | 1091.50763130 g/mol |
Topological Polar Surface Area (TPSA) | 362.00 Ų |
XlogP | -0.40 |
Atomic LogP (AlogP) | -0.96 |
H-Bond Acceptor | 14 |
H-Bond Donor | 12 |
Rotatable Bonds | 18 |
There are no found synonyms. |
![2D Structure of 6-Amino-2-[[8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carbonyl]amino]hexanoic acid 2D Structure of 6-Amino-2-[[8-benzyl-11-(hydroxymethyl)-2-[[3-(4-hydroxyphenyl)-2-[[1-(5-oxopyrrolidine-2-carbonyl)pyrrolidine-2-carbonyl]amino]propanoyl]amino]-3,6,9,12-tetraoxo-5-propan-2-yl-1,4,7,10,13-pentazatricyclo[14.6.1.017,22]tricosa-16(23),17,19,21-tetraene-14-carbonyl]amino]hexanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/733a2080-8219-11ee-ad22-c5857eb63393.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9215 | 92.15% |
Caco-2 | - | 0.8694 | 86.94% |
Blood Brain Barrier | - | 0.9000 | 90.00% |
Human oral bioavailability | - | 0.6857 | 68.57% |
Subcellular localzation | Nucleus | 0.3732 | 37.32% |
OATP2B1 inhibitior | - | 0.7132 | 71.32% |
OATP1B1 inhibitior | + | 0.8386 | 83.86% |
OATP1B3 inhibitior | + | 0.9352 | 93.52% |
MATE1 inhibitior | - | 0.8438 | 84.38% |
OCT2 inhibitior | - | 0.7750 | 77.50% |
BSEP inhibitior | + | 0.9341 | 93.41% |
P-glycoprotein inhibitior | + | 0.7444 | 74.44% |
P-glycoprotein substrate | + | 0.8803 | 88.03% |
CYP3A4 substrate | + | 0.7548 | 75.48% |
CYP2C9 substrate | - | 0.6032 | 60.32% |
CYP2D6 substrate | - | 0.8164 | 81.64% |
CYP3A4 inhibition | - | 0.8704 | 87.04% |
CYP2C9 inhibition | - | 0.8865 | 88.65% |
CYP2C19 inhibition | - | 0.8228 | 82.28% |
CYP2D6 inhibition | - | 0.9045 | 90.45% |
CYP1A2 inhibition | - | 0.9258 | 92.58% |
CYP2C8 inhibition | + | 0.7420 | 74.20% |
CYP inhibitory promiscuity | - | 0.7457 | 74.57% |
UGT catelyzed | + | 0.8000 | 80.00% |
Carcinogenicity (binary) | - | 0.8700 | 87.00% |
Carcinogenicity (trinary) | Non-required | 0.6167 | 61.67% |
Eye corrosion | - | 0.9897 | 98.97% |
Eye irritation | - | 0.8996 | 89.96% |
Skin irritation | - | 0.7859 | 78.59% |
Skin corrosion | - | 0.9404 | 94.04% |
Ames mutagenesis | - | 0.7300 | 73.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6604 | 66.04% |
Micronuclear | + | 0.9300 | 93.00% |
Hepatotoxicity | - | 0.5647 | 56.47% |
skin sensitisation | - | 0.8852 | 88.52% |
Respiratory toxicity | + | 0.8333 | 83.33% |
Reproductive toxicity | + | 0.9889 | 98.89% |
Mitochondrial toxicity | + | 0.9625 | 96.25% |
Nephrotoxicity | - | 0.8435 | 84.35% |
Acute Oral Toxicity (c) | III | 0.6025 | 60.25% |
Estrogen receptor binding | + | 0.7759 | 77.59% |
Androgen receptor binding | + | 0.6656 | 66.56% |
Thyroid receptor binding | + | 0.5358 | 53.58% |
Glucocorticoid receptor binding | + | 0.5722 | 57.22% |
Aromatase binding | + | 0.6172 | 61.72% |
PPAR gamma | + | 0.7267 | 72.67% |
Honey bee toxicity | - | 0.6971 | 69.71% |
Biodegradation | - | 0.8000 | 80.00% |
Crustacea aquatic toxicity | + | 0.5500 | 55.00% |
Fish aquatic toxicity | + | 0.6717 | 67.17% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 99.94% | 98.95% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 99.29% | 90.08% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.08% | 96.09% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 98.87% | 83.82% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 98.28% | 95.56% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 98.22% | 97.64% |
CHEMBL3837 | P07711 | Cathepsin L | 98.19% | 96.61% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.51% | 91.11% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 97.44% | 93.10% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 97.33% | 91.71% |
CHEMBL4777 | P25929 | Neuropeptide Y receptor type 1 | 96.16% | 96.67% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 95.92% | 94.45% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 95.82% | 97.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 95.77% | 93.56% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.76% | 88.56% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 95.27% | 82.69% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 95.18% | 97.23% |
CHEMBL4979 | P13866 | Sodium/glucose cotransporter 1 | 94.64% | 98.24% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 94.54% | 93.99% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 94.50% | 97.14% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.82% | 95.89% |
CHEMBL2514 | O95665 | Neurotensin receptor 2 | 93.80% | 100.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.58% | 99.17% |
CHEMBL236 | P41143 | Delta opioid receptor | 92.99% | 99.35% |
CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 92.96% | 98.33% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 91.69% | 95.89% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 91.12% | 85.00% |
CHEMBL217 | P14416 | Dopamine D2 receptor | 91.03% | 95.62% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 90.31% | 80.71% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 90.29% | 96.47% |
CHEMBL5805 | Q9NR97 | Toll-like receptor 8 | 89.95% | 96.25% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 89.65% | 100.00% |
CHEMBL237 | P41145 | Kappa opioid receptor | 88.36% | 98.10% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 88.13% | 94.75% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 87.57% | 93.00% |
CHEMBL1921 | P47901 | Vasopressin V1b receptor | 87.34% | 92.50% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.94% | 95.50% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 85.43% | 95.93% |
CHEMBL3476 | O15111 | Inhibitor of nuclear factor kappa B kinase alpha subunit | 84.47% | 95.83% |
CHEMBL4101 | P17612 | cAMP-dependent protein kinase alpha-catalytic subunit | 83.12% | 82.86% |
CHEMBL4394 | Q9NYA1 | Sphingosine kinase 1 | 83.06% | 96.03% |
CHEMBL1907591 | P30926 | Neuronal acetylcholine receptor; alpha4/beta4 | 82.77% | 100.00% |
CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.38% | 92.97% |
CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 82.30% | 94.66% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 81.68% | 90.20% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.59% | 90.71% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 80.52% | 91.19% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.13% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
PubChem | 72775034 |
LOTUS | LTS0016258 |
wikiData | Q104951815 |