(2R)-2-[[(8S,9R,12R,15R,18S,21S,27R)-12-[(2S)-butan-2-yl]-21-[3-(diaminomethylideneamino)propyl]-10,13,16,19,22,25-hexaoxo-9-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]-8,15-di(propan-2-yl)-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]butanedioic acid
Internal ID | 9a1fa2df-3fe6-4818-aae4-ae9920b64b7a |
Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Peptides > Cyclic peptides |
IUPAC Name | (2R)-2-[[(8S,9R,12R,15R,18S,21S,27R)-12-[(2S)-butan-2-yl]-21-[3-(diaminomethylideneamino)propyl]-10,13,16,19,22,25-hexaoxo-9-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]-8,15-di(propan-2-yl)-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]butanedioic acid |
SMILES (Canonical) | CCC(C)C1C(=O)NC(C(=O)NC2CC3=C(NC4=C3C=CC(=C4)C(C(C(=O)N1)NC(=O)C5CCC(=O)N5)C(C)C)N6C=C(CC(NC(=O)CNC(=O)C(NC2=O)CCCN=C(N)N)C(=O)NC(CC(=O)O)C(=O)O)N=C6)C(C)C |
SMILES (Isomeric) | CC[C@H](C)[C@@H]1C(=O)N[C@@H](C(=O)N[C@H]2CC3=C(NC4=C3C=CC(=C4)[C@@H]([C@H](C(=O)N1)NC(=O)[C@H]5CCC(=O)N5)C(C)C)N6C=C(C[C@@H](NC(=O)CNC(=O)[C@@H](NC2=O)CCCN=C(N)N)C(=O)N[C@H](CC(=O)O)C(=O)O)N=C6)C(C)C |
InChI | InChI=1S/C51H71N15O13/c1-7-24(6)40-48(76)63-39(23(4)5)47(75)61-33-17-28-27-11-10-25(38(22(2)3)41(49(77)64-40)65-44(72)30-12-13-35(67)57-30)15-31(27)59-42(28)66-20-26(56-21-66)16-32(45(73)62-34(50(78)79)18-37(69)70)58-36(68)19-55-43(71)29(60-46(33)74)9-8-14-54-51(52)53/h10-11,15,20-24,29-30,32-34,38-41,59H,7-9,12-14,16-19H2,1-6H3,(H,55,71)(H,57,67)(H,58,68)(H,60,74)(H,61,75)(H,62,73)(H,63,76)(H,64,77)(H,65,72)(H,69,70)(H,78,79)(H4,52,53,54)/t24-,29-,30+,32+,33-,34+,38-,39+,40+,41+/m0/s1 |
InChI Key | KFGFIFOXJSPNCK-UIAGNESMSA-N |
Popularity | 0 references in papers |
Molecular Formula | C51H71N15O13 |
Molecular Weight | 1102.20 g/mol |
Exact Mass | 1101.53557738 g/mol |
Topological Polar Surface Area (TPSA) | 435.00 Ų |
XlogP | -0.70 |
Atomic LogP (AlogP) | -2.69 |
H-Bond Acceptor | 14 |
H-Bond Donor | 14 |
Rotatable Bonds | 15 |
There are no found synonyms. |
![2D Structure of (2R)-2-[[(8S,9R,12R,15R,18S,21S,27R)-12-[(2S)-butan-2-yl]-21-[3-(diaminomethylideneamino)propyl]-10,13,16,19,22,25-hexaoxo-9-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]-8,15-di(propan-2-yl)-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]butanedioic acid 2D Structure of (2R)-2-[[(8S,9R,12R,15R,18S,21S,27R)-12-[(2S)-butan-2-yl]-21-[3-(diaminomethylideneamino)propyl]-10,13,16,19,22,25-hexaoxo-9-[[(2R)-5-oxopyrrolidine-2-carbonyl]amino]-8,15-di(propan-2-yl)-2,11,14,17,20,23,26,30,32-nonazapentacyclo[16.14.2.13,7.129,32.04,33]hexatriaconta-1(33),3,5,7(36),29(35),30-hexaene-27-carbonyl]amino]butanedioic acid](https://plantaedb.com/storage/docs/compounds/2023/11/70b682d0-8569-11ee-a3fe-074bdd6d58f2.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
Human Intestinal Absorption | + | 0.9008 | 90.08% |
Caco-2 | - | 0.8642 | 86.42% |
Blood Brain Barrier | - | 0.6000 | 60.00% |
Human oral bioavailability | - | 0.6286 | 62.86% |
Subcellular localzation | Lysosomes | 0.4063 | 40.63% |
OATP2B1 inhibitior | - | 0.8575 | 85.75% |
OATP1B1 inhibitior | + | 0.8038 | 80.38% |
OATP1B3 inhibitior | + | 0.9384 | 93.84% |
MATE1 inhibitior | - | 0.7209 | 72.09% |
OCT2 inhibitior | - | 0.6750 | 67.50% |
BSEP inhibitior | + | 0.9748 | 97.48% |
P-glycoprotein inhibitior | + | 0.7450 | 74.50% |
P-glycoprotein substrate | + | 0.8671 | 86.71% |
CYP3A4 substrate | + | 0.7403 | 74.03% |
CYP2C9 substrate | - | 0.5968 | 59.68% |
CYP2D6 substrate | - | 0.8534 | 85.34% |
CYP3A4 inhibition | - | 0.9331 | 93.31% |
CYP2C9 inhibition | - | 0.8396 | 83.96% |
CYP2C19 inhibition | - | 0.7998 | 79.98% |
CYP2D6 inhibition | - | 0.8937 | 89.37% |
CYP1A2 inhibition | - | 0.8142 | 81.42% |
CYP2C8 inhibition | + | 0.8386 | 83.86% |
CYP inhibitory promiscuity | - | 0.9489 | 94.89% |
UGT catelyzed | - | 0.0000 | 0.00% |
Carcinogenicity (binary) | - | 0.8800 | 88.00% |
Carcinogenicity (trinary) | Non-required | 0.6141 | 61.41% |
Eye corrosion | - | 0.9849 | 98.49% |
Eye irritation | - | 0.8986 | 89.86% |
Skin irritation | - | 0.7698 | 76.98% |
Skin corrosion | - | 0.9297 | 92.97% |
Ames mutagenesis | - | 0.6200 | 62.00% |
Human Ether-a-go-go-Related Gene inhibition | + | 0.6478 | 64.78% |
Micronuclear | + | 0.9200 | 92.00% |
Hepatotoxicity | + | 0.6178 | 61.78% |
skin sensitisation | - | 0.8428 | 84.28% |
Respiratory toxicity | + | 0.8111 | 81.11% |
Reproductive toxicity | + | 0.9222 | 92.22% |
Mitochondrial toxicity | + | 0.8375 | 83.75% |
Nephrotoxicity | - | 0.7934 | 79.34% |
Acute Oral Toxicity (c) | III | 0.5218 | 52.18% |
Estrogen receptor binding | + | 0.7420 | 74.20% |
Androgen receptor binding | + | 0.7212 | 72.12% |
Thyroid receptor binding | + | 0.6346 | 63.46% |
Glucocorticoid receptor binding | + | 0.5924 | 59.24% |
Aromatase binding | + | 0.7034 | 70.34% |
PPAR gamma | + | 0.7684 | 76.84% |
Honey bee toxicity | - | 0.6841 | 68.41% |
Biodegradation | - | 0.8750 | 87.50% |
Crustacea aquatic toxicity | - | 0.5600 | 56.00% |
Fish aquatic toxicity | + | 0.8183 | 81.83% |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.98% | 83.82% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.89% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 99.67% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.65% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.06% | 91.11% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 97.04% | 90.24% |
CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 96.22% | 90.08% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 96.17% | 97.09% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 95.56% | 99.17% |
CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 95.47% | 88.56% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 95.43% | 98.59% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 94.42% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 94.36% | 98.75% |
CHEMBL220 | P22303 | Acetylcholinesterase | 94.30% | 94.45% |
CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 94.28% | 93.10% |
CHEMBL1937 | Q92769 | Histone deacetylase 2 | 93.89% | 94.75% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 93.84% | 95.89% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 93.74% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.02% | 96.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 91.82% | 93.56% |
CHEMBL4506 | Q96EB6 | NAD-dependent deacetylase sirtuin 1 | 90.49% | 88.33% |
CHEMBL2693 | Q9UIQ6 | Cystinyl aminopeptidase | 89.91% | 97.64% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.90% | 95.56% |
CHEMBL3286 | P00749 | Urokinase-type plasminogen activator | 88.89% | 97.88% |
CHEMBL1781 | P11387 | DNA topoisomerase I | 88.69% | 97.00% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 88.59% | 97.23% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 88.35% | 96.47% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 87.24% | 80.71% |
CHEMBL5896 | O75164 | Lysine-specific demethylase 4A | 87.01% | 99.09% |
CHEMBL4071 | P08311 | Cathepsin G | 86.88% | 94.64% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.80% | 89.00% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.82% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.21% | 86.33% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 84.42% | 95.56% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 84.01% | 99.23% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.57% | 90.00% |
CHEMBL236 | P41143 | Delta opioid receptor | 83.55% | 99.35% |
CHEMBL2243 | O00519 | Anandamide amidohydrolase | 83.05% | 97.53% |
CHEMBL1991 | O14920 | Inhibitor of nuclear factor kappa B kinase beta subunit | 83.01% | 97.15% |
CHEMBL2815 | P04629 | Nerve growth factor receptor Trk-A | 82.76% | 87.16% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 81.85% | 100.00% |
CHEMBL4461 | Q9NTG7 | NAD-dependent deacetylase sirtuin 3 | 81.85% | 94.36% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.52% | 100.00% |
CHEMBL3784 | Q09472 | Histone acetyltransferase p300 | 81.15% | 93.33% |
CHEMBL2443 | P49862 | Kallikrein 7 | 81.15% | 94.00% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 80.96% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Celosia argentea |
PubChem | 163091759 |
LOTUS | LTS0260354 |
wikiData | Q105140363 |