(1R,5R,6R,11R,12S,14S,17R,20S,21S)-21-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docos-15-en-19-one
Internal ID | 1f4bebe1-4eca-4fa4-b7f4-0bf8c2cc1512 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Villanovane, atisane, trachylobane or helvifulvane diterpenoids > Atisane diterpenoids |
IUPAC Name | (1R,5R,6R,11R,12S,14S,17R,20S,21S)-21-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docos-15-en-19-one |
SMILES (Canonical) | CC1=CC23CC(=O)C4C5(CCCC46C2(CC1CC3C6N7C5OCC7)O)C |
SMILES (Isomeric) | CC1=C[C@@]23CC(=O)[C@@H]4[C@]5(CCC[C@@]46[C@@]2(C[C@@H]1C[C@@H]3[C@H]6N7[C@@H]5OCC7)O)C |
InChI | InChI=1S/C22H29NO3/c1-12-9-20-11-15(24)16-19(2)4-3-5-21(16)17(23-6-7-26-18(19)23)14(20)8-13(12)10-22(20,21)25/h9,13-14,16-18,25H,3-8,10-11H2,1-2H3/t13-,14+,16+,17+,18+,19+,20-,21+,22-/m0/s1 |
InChI Key | BDYVYNKEWLPLCY-FTYXNQKISA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H29NO3 |
Molecular Weight | 355.50 g/mol |
Exact Mass | 355.21474379 g/mol |
Topological Polar Surface Area (TPSA) | 49.80 Ų |
XlogP | 1.60 |
There are no found synonyms. |
![2D Structure of (1R,5R,6R,11R,12S,14S,17R,20S,21S)-21-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docos-15-en-19-one 2D Structure of (1R,5R,6R,11R,12S,14S,17R,20S,21S)-21-hydroxy-5,15-dimethyl-7-oxa-10-azaheptacyclo[12.6.2.01,11.05,20.06,10.012,17.017,21]docos-15-en-19-one](https://plantaedb.com/storage/docs/compounds/2023/11/70ad45c0-855e-11ee-ad3e-bdf5e27ead4b.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 95.46% | 97.25% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 93.79% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.06% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.41% | 95.56% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 89.44% | 93.04% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.21% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 88.67% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.36% | 94.45% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 86.94% | 93.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 86.49% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 85.08% | 90.71% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.40% | 89.00% |
CHEMBL4026 | P40763 | Signal transducer and activator of transcription 3 | 84.13% | 82.69% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.31% | 100.00% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 83.11% | 92.94% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.59% | 97.09% |
CHEMBL4829 | O00763 | Acetyl-CoA carboxylase 2 | 81.48% | 98.00% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.12% | 94.00% |
CHEMBL2781 | P19634 | Sodium/hydrogen exchanger 1 | 80.75% | 90.24% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.59% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Thalictrum javanicum |
PubChem | 162929144 |
LOTUS | LTS0132324 |
wikiData | Q104932513 |