7-Methoxy-5-(2-methoxyethenyl)-2-(4-methoxy-3-methylphenyl)-3-methyl-2,3-dihydro-1-benzofuran
| Internal ID | 76029c02-527e-4ddd-8c7a-5e2dd8e99128 |
| Taxonomy | Phenylpropanoids and polyketides > 2-arylbenzofuran flavonoids |
| IUPAC Name | 7-methoxy-5-(2-methoxyethenyl)-2-(4-methoxy-3-methylphenyl)-3-methyl-2,3-dihydro-1-benzofuran |
| SMILES (Canonical) | CC1C(OC2=C1C=C(C=C2OC)C=COC)C3=CC(=C(C=C3)OC)C |
| SMILES (Isomeric) | CC1C(OC2=C1C=C(C=C2OC)C=COC)C3=CC(=C(C=C3)OC)C |
| InChI | InChI=1S/C21H24O4/c1-13-10-16(6-7-18(13)23-4)20-14(2)17-11-15(8-9-22-3)12-19(24-5)21(17)25-20/h6-12,14,20H,1-5H3 |
| InChI Key | QZAHBLCOKNOTJV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16745924 g/mol |
| Topological Polar Surface Area (TPSA) | 36.90 Ų |
| XlogP | 4.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.11% | 96.00% |
| CHEMBL1163125 | O60885 | Bromodomain-containing protein 4 | 92.68% | 97.31% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.49% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.65% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.69% | 89.62% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.97% | 94.73% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 86.79% | 89.00% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 85.19% | 90.24% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 85.18% | 97.14% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.06% | 96.09% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.71% | 85.14% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 82.28% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Machilus japonica |
| PubChem | 85133933 |
| LOTUS | LTS0216841 |
| wikiData | Q105231393 |