7-(Hydroxymethyl)-2-methylnaphthalene-1,4-dione
| Internal ID | 61976719-6a64-4d24-9bfc-e20960ab0c79 |
| Taxonomy | Benzenoids > Naphthalenes > Naphthoquinones |
| IUPAC Name | 7-(hydroxymethyl)-2-methylnaphthalene-1,4-dione |
| SMILES (Canonical) | CC1=CC(=O)C2=C(C1=O)C=C(C=C2)CO |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(C1=O)C=C(C=C2)CO |
| InChI | InChI=1S/C12H10O3/c1-7-4-11(14)9-3-2-8(6-13)5-10(9)12(7)15/h2-5,13H,6H2,1H3 |
| InChI Key | XJPXMQYKZCXRCW-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 54.40 Ų |
| XlogP | 1.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 98.58% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.61% | 95.56% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.60% | 90.24% |
| CHEMBL2378 | P30307 | Dual specificity phosphatase Cdc25C | 85.60% | 96.67% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 83.68% | 94.73% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.09% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pyrola rotundifolia |
| PubChem | 11820154 |
| LOTUS | LTS0090679 |
| wikiData | Q105329133 |