[7-Hydroxy-5-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-(3-hydroxyphenyl)methanone
| Internal ID | 1f8e9587-3240-4558-8ac4-3abee3098e1c |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Benzophenones |
| IUPAC Name | [7-hydroxy-5-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-(3-hydroxyphenyl)methanone |
| SMILES (Canonical) | CC(=CCC1=C(C(=C(C2=C1OC(C=C2)(C)C)OC)C(=O)C3=CC(=CC=C3)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C(=C(C2=C1OC(C=C2)(C)C)OC)C(=O)C3=CC(=CC=C3)O)O)C |
| InChI | InChI=1S/C24H26O5/c1-14(2)9-10-17-21(27)19(20(26)15-7-6-8-16(25)13-15)23(28-5)18-11-12-24(3,4)29-22(17)18/h6-9,11-13,25,27H,10H2,1-5H3 |
| InChI Key | VSLUMVDOGOTCIR-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C24H26O5 |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.17802393 g/mol |
| Topological Polar Surface Area (TPSA) | 76.00 Ų |
| XlogP | 5.90 |
| There are no found synonyms. |
![2D Structure of [7-Hydroxy-5-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-(3-hydroxyphenyl)methanone](https://plantaedb.com/storage/docs/compounds/2023/11/7-hydroxy-5-methoxy-22-dimethyl-8-3-methylbut-2-enylchromen-6-yl-3-hydroxyphenylmethanone.jpg "2D Structure of [7-Hydroxy-5-methoxy-2,2-dimethyl-8-(3-methylbut-2-enyl)chromen-6-yl]-(3-hydroxyphenyl)methanone")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.37% | 91.11% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.33% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 94.21% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 94.05% | 98.75% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 92.90% | 90.17% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.52% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.47% | 99.17% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.20% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.63% | 98.95% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 87.25% | 91.07% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.98% | 91.19% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.48% | 89.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 84.36% | 95.50% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.12% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 82.59% | 85.14% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.57% | 90.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 80.62% | 90.20% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Vismia cayennensis |
| PubChem | 163106349 |
| LOTUS | LTS0080604 |
| wikiData | Q105292312 |