7-hydroxy-4-[5-(hydroxymethyl)furan-2-yl]-1H-quinolin-2-one
| Internal ID | b298668c-7d28-4085-99eb-f6a97a181faf |
| Taxonomy | Organoheterocyclic compounds > Quinolines and derivatives > Quinolones and derivatives > Hydroquinolones |
| IUPAC Name | 7-hydroxy-4-[5-(hydroxymethyl)furan-2-yl]-1H-quinolin-2-one |
| SMILES (Canonical) | C1=CC2=C(C=C1O)NC(=O)C=C2C3=CC=C(O3)CO |
| SMILES (Isomeric) | C1=CC2=C(C=C1O)NC(=O)C=C2C3=CC=C(O3)CO |
| InChI | InChI=1S/C14H11NO4/c16-7-9-2-4-13(19-9)11-6-14(18)15-12-5-8(17)1-3-10(11)12/h1-6,16-17H,7H2,(H,15,18) |
| InChI Key | IDBBBZPURJJTCL-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.06880783 g/mol |
| Topological Polar Surface Area (TPSA) | 82.70 Ų |
| XlogP | 0.40 |
| There are no found synonyms. |
![2D Structure of 7-hydroxy-4-[5-(hydroxymethyl)furan-2-yl]-1H-quinolin-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/7-hydroxy-4-5-hydroxymethylfuran-2-yl-1h-quinolin-2-one.jpg "2D Structure of 7-hydroxy-4-[5-(hydroxymethyl)furan-2-yl]-1H-quinolin-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.55% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.18% | 98.95% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 94.03% | 91.71% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.92% | 95.56% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 92.28% | 93.99% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 91.95% | 98.35% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.69% | 94.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.66% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.40% | 89.00% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 88.60% | 83.57% |
| CHEMBL2292 | Q13627 | Dual-specificity tyrosine-phosphorylation regulated kinase 1A | 85.89% | 93.24% |
| CHEMBL2535 | P11166 | Glucose transporter | 84.64% | 98.75% |
| CHEMBL1781 | P11387 | DNA topoisomerase I | 82.47% | 97.00% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.22% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.58% | 96.95% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.49% | 99.15% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.07% | 99.23% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 80.01% | 94.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Aquilegia ecalcarata |
| PubChem | 91414831 |
| LOTUS | LTS0122837 |
| wikiData | Q105111264 |